•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

p38 MAPK

Set Ascending Direction

   

Items 11 to 20 of 23 total

  1. 1
  2. 2
  3. 3
  1. R1487 HCl

    CAS No.: 449808-64-4
    Catalog No.: 157323
    Purity: 95%
    MF: C19H19ClF2N4O3
    MW: 424.835
    Storage: 2-8 degree Celsius
    SMILES: Cl.CN1C(=O)C(OC2=C(F)C=C(F)C=C2)=CC2=C1N=C(NC1CCOCC1)N=C2
  2. BMS-582949

    CAS No.: 623152-17-0
    Catalog No.: 152163
    Purity: 95%
    MF: C22H26N6O2
    MW: 406.49
    Storage: 2-8 degree Celsius
    SMILES: CCCNC(=O)C1=CN2N=CN=C(NC3=C(C)C=CC(=C3)C(=O)NC3CC3)C2=C1C
  3. VX-745

    CAS No.: 209410-46-8
    Catalog No.: 101973
    Purity: 95%
    MF: C19H9Cl2F2N3OS
    MW: 436.27
    Storage: 2-8 degree Celsius
  4. BIRB 796; Doramapimod

    CAS No.: 285983-48-4
    Catalog No.: 129033
    Purity: 95%
    MF: C31H37N5O3
    MW: 527.669
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)N1N=C(C=C1NC(=O)NC1=CC=C(OCCN2CCOCC2)C2=CC=CC=C12)C(C)(C)C
  5. TAK-715

    CAS No.: 303162-79-0
    Catalog No.: 112424
    Purity: 95%
    MF: C24H21N3OS
    MW: 399.519
    Storage: 2-8 degree Celsius
  6. SB 242235

    CAS No.: 193746-75-7
    Catalog No.: 112423
    Purity: 95%
    MF: C19H20FN5O
    MW: 353.401
    Storage: 2-8 degree Celsius
  7. Skepinone-L

    CAS No.: 1221485-83-1
    Catalog No.: 111936
    Purity: 95%
    MF: C24H21F2NO4
    MW: 425.431
    Storage: 2-8 degree Celsius
  8. SB203580

    CAS No.: 152121-47-6
    Catalog No.: 110101
    Purity: 95%
    MF: C21H16FN3OS
    MW: 377.444
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)C1=CC=C(C=C1)C1=NC(=C(N1)C1=CC=C(F)C=C1)C1=CC=NC=C1
  9. VX-702

    CAS No.: 745833-23-2
    Catalog No.: 109835
    Purity: 95%
    MF: C19H12F4N4O2
    MW: 404.323
    Storage: 2-8 degree Celsius
  10. PH-797804

    CAS No.: 586379-66-0
    Catalog No.: 109802
    Purity: 95%
    MF: C22H19BrF2N2O3
    MW: 477.305
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 23 total

  1. 1
  2. 2
  3. 3