•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

p38 MAPK

Set Descending Direction

   

Items 1 to 10 of 23 total

  1. 1
  2. 2
  3. 3
  1. SB239063

    CAS No.: 193551-21-2
    Catalog No.: 152073
    Purity: 95%
    MF: C20H21FN4O2
    MW: 368.412
    Storage: 2-8 degree Celsius
    SMILES: COC1=NC=CC(=N1)C1=C(N=CN1[C@H]1CC[C@H](O)CC1)C1=CC=C(F)C=C1
  2. SB 203580 hydrochloride; RWJ 64809 hydrochloride; Adezmapimod hydrochloride

    CAS No.: 869185-85-3
    Catalog No.: WLZ0323
    Purity: 95%
    MF: C21H17ClFN3OS
    MW: 413.905
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC1=CC=C(C=C1)C1=C(N=C(N1)C1=CC=C(C=C1)S(=O)C)C1=CC=NC=C1
  3. RWJ-67657

    CAS No.: 215303-72-3
    Catalog No.: WLZ0251
    Purity: 95%
    MF: C27H24FN3O
    MW: 425.507
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)C=1N=C(N(C1C1=CC=NC=C1)CCCC1=CC=CC=C1)C#CCCO
  4. Acumapimod

    CAS No.: 836683-15-9
    Catalog No.: 186440
    Purity: 95%
    MF: C22H19N5O2
    MW: 385.427
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=NN1C=1C=C(C(=O)NC2CC2)C=CC1C)C(C1=CC(=CC=C1)C#N)=O
  5. TA-02

    CAS No.: 1784751-19-4
    Catalog No.: 169549
    Purity: 95%
    MF: C20H13F2N3
    MW: 333.341
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)C1=C(NC(=N1)C1=C(F)C=CC=C1)C1=CC=NC=C1
  6. Pamapimod

    CAS No.: 449811-01-2
    Catalog No.: 158509
    Purity: 95%
    MF: C19H20F2N4O4
    MW: 406.389
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=O)C(OC2=C(F)C=C(F)C=C2)=CC2=C1N=C(NC(CCO)CCO)N=C2
  7. SKF-86002

    CAS No.: 72873-74-6
    Catalog No.: 157241
    Purity: 95%
    MF: C16H12FN3S
    MW: 297.358
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)C1=C(N2CCSC2=N1)C1=CC=NC=C1
  8. Losmapimod; GW856553X

    CAS No.: 585543-15-3
    Catalog No.: 141881
    Purity: 95%
    MF: C22H26FN3O2
    MW: 383.467
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=C(C=C1F)C(=O)NC1CC1)C1=CC=C(C=N1)C(=O)NCC(C)(C)C
  9. SD-06

    CAS No.: 271576-80-8
    Catalog No.: 186257
    Purity: 95%
    MF: C20H20ClN5O2
    MW: 397.866
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C1=C(C(=NN1)C1CCN(CC1)C(CO)=O)C1=NC=NC=C1
  10. APS-2-79 hydrochloride

    CAS No.: 2002381-31-7
    Catalog No.: 186241
    Purity: 95%
    MF: C23H22ClN3O3
    MW: 423.9
    Storage: 2-8 degree Celsius
    SMILES: Cl.COC=1C=C2C(=NC=NC2=CC1OC)NC1=C(C=C(C=C1)OC1=CC=CC=C1)C
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 23 total

  1. 1
  2. 2
  3. 3