•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Oxazolidines

Set Ascending Direction

   

Items 61 to 70 of 78 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. (R)-3-(4-bromophenyl)-5-(hydroxymethyl)oxazolidin-2-one

    CAS No.: 1252686-47-7
    Catalog No.: TQP0898
    Purity: 95%
    MF: C10H10BrNO3
    MW: 272.098
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)N1C(O[C@H](C1)CO)=O
  2. 3-(piperidin-3-yl)-1,3-oxazolidin-2-one

    CAS No.: 1251206-02-6
    Catalog No.: 194283
    Purity: 95%
    MF: C8H14N2O2
    MW: 170.212
    Storage: 2-8 degree Celsius
    SMILES: N1CC(CCC1)N1C(OCC1)=O
  3. (S,E)-4-benzyl-3-(but-2-enoyl)oxazolidin-2-one

    CAS No.: 133812-16-5
    Catalog No.: 191651
    Purity: 95%
    MF: C14H15NO3
    MW: 245.278
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)[C@@H]1N(C(OC1)=O)C(\C=C\C)=O
  4. (S)-methyl 5-oxo-5-(2-oxo-4-phenyloxazolidin-3-yl)pentanoate

    CAS No.: 477558-79-5
    Catalog No.: 191250
    Purity: 95%
    MF: C15H17NO5
    MW: 291.303
    Storage: 2-8 degree Celsius
    SMILES: O=C(CCCC(=O)OC)N1C(OC[C@@H]1C1=CC=CC=C1)=O
  5. (4R,5S)-4-methyl-5-phenyl-3-propionyloxazolidin-2-one

    CAS No.: 77877-20-4
    Catalog No.: 189007
    Purity: 95%
    MF: C13H15NO3
    MW: 233.267
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1N(C(O[C@H]1C1=CC=CC=C1)=O)C(CC)=O
  6. (S)-4-methyl-2-oxazolidinone

    CAS No.: 4042-35-7
    Catalog No.: 182286
    Purity: 95%
    MF: C4H7NO2
    MW: 101.105
    Storage: 2-8 degree Celsius
    SMILES: C[C@H]1COC(=O)N1
  7. 3-trityl-5-oxazolidinone

    CAS No.: 115011-73-9
    Catalog No.: 173187
    Purity: 95%
    MF: C22H19NO2
    MW: 329.399
    Storage: 2-8 degree Celsius
    SMILES: O=C1CN(CO1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
  8. (R)-4-benzyl-5,5-diphenyloxazolidin-2-one

    CAS No.: 191090-40-1
    Catalog No.: 172645
    Purity: 95%
    MF: C22H19NO2
    MW: 329.399
    Storage: 2-8 degree Celsius
    SMILES: O=C1N[C@H](CC2=CC=CC=C2)C(O1)(C1=CC=CC=C1)C1=CC=CC=C1
  9. (S)-4-benzyl-5,5-diphenyloxazolidin-2-one

    CAS No.: 191090-38-7
    Catalog No.: 172644
    Purity: 95%
    MF: C22H19NO2
    MW: 329.399
    Storage: 2-8 degree Celsius
    SMILES: O=C1N[C@@H](CC2=CC=CC=C2)C(O1)(C1=CC=CC=C1)C1=CC=CC=C1
  10. (S)-ethyl 2-((S)-4-methyl-2,5-dioxooxazolidin-3-yl)-4-phenylbutanoate

    CAS No.: 84793-24-8
    Catalog No.: 146238
    Purity: 95%
    MF: C16H19NO5
    MW: 305.33
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)[C@H](CCC1=CC=CC=C1)N1[C@@H](C)C(=O)OC1=O
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 78 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8