•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Oxazoles

Set Ascending Direction

   

Items 41 to 50 of 175 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole

    CAS No.: 942070-84-0
    Catalog No.: 163136
    Purity: 95%
    MF: C9H14BNO3
    MW: 195.027
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)C1=CN=CO1
  2. (4S,4'S)-2,2'-(propane-2,2-diyl)bis(4-(tert-butyl)-4,5-dihydrooxazole)

    CAS No.: 131833-93-7
    Catalog No.: 168549
    Purity: 95%
    MF: C17H30N2O2
    MW: 294.439
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)[C@H]1COC(=N1)C(C)(C)C1=N[C@H](CO1)C(C)(C)C
  3. 4,5-diphenyl-2,3-dihydro-1,3-oxazole-2-thione

    CAS No.: 6670-13-9
    Catalog No.: 170109
    Purity: 95%
    MF: C15H11NOS
    MW: 253.326
    Storage: 2-8 degree Celsius
    SMILES: S=C1NC(=C(O1)C1=CC=CC=C1)C1=CC=CC=C1
  4. methyl 2-chlorooxazole-4-carboxylate

    CAS No.: 934236-35-8
    Catalog No.: 183020
    Purity: 95%
    MF: C5H4ClNO3
    MW: 161.544
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=COC(Cl)=N1
  5. tert-butyl oxazol-5-ylmethylcarbamate

    CAS No.: 209589-20-8
    Catalog No.: 188419
    Purity: 95%
    MF: C9H14N2O3
    MW: 198.222
    Storage: 2-8 degree Celsius
    SMILES: O1C=NC=C1CNC(OC(C)(C)C)=O
  6. 5-methoxy-2-phenyloxazole

    CAS No.: 40527-16-0
    Catalog No.: 191476
    Purity: 95%
    MF: C10H9NO2
    MW: 175.187
    Storage: 2-8 degree Celsius
    SMILES: COC1=CN=C(O1)C1=CC=CC=C1
  7. 3-amino-5-methylisoxazole

    CAS No.: 1072-67-9
    Catalog No.: 199017
    Purity: 95%
    MF: C4H6N2O
    MW: 98.105
    Storage: 2-8 degree Celsius
    SMILES: NC1=NOC(=C1)C
  8. 5-(cyclopropylmethyl)-3-methylisoxazole

    CAS No.: 2384286-74-0
    Catalog No.: 199230
    Purity: 95%
    MF: C8H11NO
    MW: 137.182
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)CC1=CC(=NO1)C
  9. 5-phenyloxazole-2-thiol

    CAS No.: 16172-23-9
    Catalog No.: 199248
    Purity: 95%
    MF: C9H7NOS
    MW: 177.228
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1=CN=C(O1)S
  10. (5-bromooxazol-2-yl)methanol

    CAS No.: 1454907-14-2
    Catalog No.: 199356
    Purity: 95%
    MF: C4H4BrNO2
    MW: 177.985
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CN=C(O1)CO
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 175 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7