•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Oxazoles

Set Ascending Direction

   

Items 1 to 10 of 605 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 5-methylisoxazol-3-ylcarbamate

    CAS No.: 97517-66-3
    Catalog No.: 100917
    Purity: 95%
    MF: C9H14N2O3
    MW: 198.222
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(NC(=O)OC(C)(C)C)=NO1
  2. 5-(1-phenylprop-1-en-2-yl)isoxazole

    CAS No.: 95843-19-9
    Catalog No.: 100921
    Purity: 95%
    MF: C12H11NO
    MW: 185.226
    Storage: 2-8 degree Celsius
    SMILES: C\C(=C/C1=CC=CC=C1)C1=CC=NO1
  3. 3-(1-phenylprop-1-en-2-yl)isoxazole

    CAS No.: 95843-18-8
    Catalog No.: 100922
    Purity: 95%
    MF: C12H11NO
    MW: 185.226
    Storage: 2-8 degree Celsius
    SMILES: C\C(=C/C1=CC=CC=C1)C1=NOC=C1
  4. oxazole-4-carboxamide

    CAS No.: 23012-15-9
    Catalog No.: 101127
    Purity: 95%
    MF: C4H4N2O2
    MW: 112.088
    Storage: 2-8 degree Celsius
  5. oxazole-2-carbonitrile

    CAS No.: 68776-60-3
    Catalog No.: 101128
    Purity: 95%
    MF: C4H2N2O
    MW: 94.073
    Storage: 2-8 degree Celsius
    SMILES: N#CC1=NC=CO1
  6. 4-(4-(2,4-dimethylphenyl)oxazol-2-yl)aniline

    CAS No.: 951623-01-1
    Catalog No.: 101217
    Purity: 95%
    MF: C17H16N2O
    MW: 264.328
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C2=COC(=N2)C2=CC=C(N)C=C2)C(C)=C1
  7. 5-(pyridin-2-yl)-4-tosyl-4,5-dihydrooxazole

    CAS No.: 239798-77-7
    Catalog No.: 101274
    Purity: 95%
    MF: C15H14N2O3S
    MW: 302.355
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)S(=O)(=O)C1N=COC1C1=NC=CC=C1
  8. 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoxazole

    CAS No.: 928664-98-6
    Catalog No.: 101308
    Purity: 95%
    MF: C9H14BNO3
    MW: 195.027
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)C1=CON=C1
  9. 4-methyloxazol-2-amine

    CAS No.: 35629-70-0
    Catalog No.: 101683
    Purity: 95%
    MF: C4H6N2O
    MW: 98.105
    Storage: 2-8 degree Celsius
    SMILES: CC1=COC(N)=N1
  10. ethyl 3-methylisoxazole-5-carboxylate

    CAS No.: 63366-79-0
    Catalog No.: 101700
    Purity: 95%
    MF: C7H9NO3
    MW: 155.153
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=CC(C)=NO1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 605 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5