•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Others

Set Ascending Direction

   

Items 1 to 10 of 3418 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Finafloxacin hydrochloride

    CAS No.: 209342-41-6
    Catalog No.: 100268
    Purity: 95%
    MF: C20H20ClFN4O4
    MW: 434.855
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].[H][C@]12CN(C[C@]1([H])OCCN2)C1=C(C#N)C2=C(C=C1F)C(=O)C(=CN2C1CC1)C(O)=O
  2. Necrosulfonamide

    CAS No.: 1360614-48-7
    Catalog No.: 100318
    Purity: 95%
    MF: C18H15N5O6S2
    MW: 461.481
    Storage: 2-8 degree Celsius
    SMILES: COC1=NC=CN=C1NS(=O)(=O)C1=CC=C(NC(=O)\C=C\C2=CC=C(S2)[N+]([O-])=O)C=C1
  3. NSC-672121

    CAS No.: 59147-84-1
    Catalog No.: 100570
    Purity: 95%
    MF: C13H12O3S
    MW: 248.303
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SCCO)C(=O)C2=C(C=CC=C2)C1=O
  4. Tolimidone

    CAS No.: 41964-07-2
    Catalog No.: 100568
    Purity: 95%
    MF: C11H10N2O2
    MW: 202.213
    Storage: -20 degree Celsius
    SMILES: CC1=CC(OC2=CNC(=O)N=C2)=CC=C1
  5. VK3-OCH3

    CAS No.: 255906-59-3
    Catalog No.: 100571
    Purity: 95%
    MF: C14H14O3S
    MW: 262.33
    Storage: 2-8 degree Celsius
    SMILES: COCCSC1=C(C)C(=O)C2=C(C=CC=C2)C1=O
  6. 4-(4-(1,3,4-thiadiazol-2-yl)piperazin-1-yl)-6-ethylthieno[2,3-d]pyrimidine

    CAS No.: 1359873-35-0
    Catalog No.: 100298
    Purity: 95%
    MF: C14H16N6S2
    MW: 332.458
    Storage: 2-8 degree Celsius
  7. tert-butyl 3-(1-(5-((2-fluorophenyl)ethynyl)furan-2-carbonyl)piperidin-4-yl)benzylcarbamate

    CAS No.: 725228-52-4
    Catalog No.: 100339
    Purity: 95%
    MF: C30H31FN2O4
    MW: 502.586
    Storage: 2-8 degree Celsius
  8. N-(4-methyl-5-(2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridin-4-yl)thiazol-2-yl)-1H-imidazole-1-carboxamide

    CAS No.: 1357476-70-0
    Catalog No.: 100349
    Purity: 95%
    MF: C17H16F3N5OS
    MW: 395.41
    Storage: 2-8 degree Celsius
  9. 5-(2-(1-(4-methoxyphenyl)cyclopropyl)pyridin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1395492-75-7
    Catalog No.: 100443
    Purity: 95%
    MF: C19H19N3OS
    MW: 337.448
    Storage: 2-8 degree Celsius
  10. 5-(2-(2-(4-(3-(dimethylamino)propoxy)phenyl)propan-2-yl)pyridin-4-yl)-4-methylthiazol-2-amine

    CAS No.: 1395492-87-1
    Catalog No.: 100444
    Purity: 95%
    MF: C23H30N4OS
    MW: 410.587
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 3418 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5