•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Opioid Receptor

Set Descending Direction

   

Items 1 to 10 of 22 total

  1. 1
  2. 2
  3. 3
  1. Naloxegol (oxalate)

    CAS No.: 1354744-91-4
    Catalog No.: 157298
    Purity: 95%
    MF: C36H55NO15
    MW: 741.828
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C(O)=O.[H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(CC=C)[C@]([H])(C4)[C@]1(O)CC[C@H]2OCCOCCOCCOCCOCCOCCOCCOC
  2. LY2795050

    CAS No.: 1346133-08-1
    Catalog No.: ZB1548
    Purity: 95%
    MF: C23H22ClN3O2
    MW: 407.901
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C(=O)N)C=CC1OC1=CC=C(C=C1)CN1[C@@H](CCC1)C=1C=NC=CC1
  3. Naltrexone hydrochloride

    CAS No.: 16676-29-2
    Catalog No.: WLZ1142
    Purity: 95%
    MF: C20H24ClNO4
    MW: 377.868
    Storage: 2-8 degree Celsius
    SMILES: Cl.C1(CC1)CN1[C@H]2[C@@]3(CCC([C@H]4[C@]3(CC1)C1=C(O4)C(=CC=C1C2)O)=O)O
  4. GR103545

    CAS No.: 126766-43-6
    Catalog No.: WLZ0327
    Purity: 95%
    MF: C23H29Cl2N3O7
    MW: 530.405
    Storage: 2-8 degree Celsius
    SMILES: C(\C=C\C(=O)O)(=O)O.ClC=1C=C(C=CC1Cl)CC(=O)N1[C@@H](CN(CC1)C(=O)OC)CN1CCCC1
  5. BMS-986188

    CAS No.: 1776115-10-6
    Catalog No.: 194654
    Purity: 95%
    MF: C30H31BrO4
    MW: 535.478
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(COC2=CC=C(C=C2)C2C=3C(CC(CC3OC=3CC(CC(C23)=O)(C)C)(C)C)=O)C=CC=C1
  6. BMS 986187

    CAS No.: 684238-37-7
    Catalog No.: 194653
    Purity: 95%
    MF: C31H34O4
    MW: 470.609
    Storage: 2-8 degree Celsius
    SMILES: CC1(CC(C=2C(C=3C(CC(CC3OC2C1)(C)C)=O)C1=CC=C(C=C1)OCC1=C(C=CC=C1)C)=O)C
  7. CYM51010; ML-335

    CAS No.: 1069498-96-9
    Catalog No.: 194572
    Purity: 95%
    MF: C25H32N2O3
    MW: 408.542
    Storage: 2-8 degree Celsius
    SMILES: C(C)(=O)NC1=CC=C(CN2CCC(CC2)(C(=O)OCC)CCC2=CC=CC=C2)C=C1
  8. SR17018

    CAS No.: 2134602-45-0
    Catalog No.: 186412
    Purity: 95%
    MF: C19H18Cl3N3O
    MW: 410.732
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(N(C(N2)=O)C2CCN(CC2)CC2=CC=C(C=C2)Cl)C=C1Cl
  9. AlviMopan dihydrate

    CAS No.: 170098-38-1
    Catalog No.: 158534
    Purity: 95%
    MF: C25H36N2O6
    MW: 460.571
    Storage: 2-8 degree Celsius
    SMILES: O.O.C[C@H]1CN(C[C@H](CC2=CC=CC=C2)C(=O)NCC(O)=O)CC[C@@]1(C)C1=CC(O)=CC=C1
  10. Cebranopadol(GRT-6005)

    CAS No.: 863513-91-1
    Catalog No.: 157283
    Purity: 95%
    MF: C24H27FN2O
    MW: 378.491
    Storage: 2-8 degree Celsius
    SMILES: CN(C)[C@]1(CC[C@@]2(CC1)OCCC1=C2NC2=C1C=C(F)C=C2)C1=CC=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 22 total

  1. 1
  2. 2
  3. 3