•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Nucleosides

Set Descending Direction

   

Items 1 to 10 of 33 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 2'-O-(2-Methoxyethyl)guanosine

    CAS No.: 473278-54-5
    Catalog No.: WLZ0895
    Purity: 95%
    MF: C13H19N5O6
    MW: 341.324
    Storage: 2-8 degree Celsius
    SMILES: COCCO[C@H]1[C@@H](O[C@@H]([C@H]1O)CO)N1C=NC=2C(=O)NC(N)=NC12
  2. 7-Methyl-guanosine

    CAS No.: 15313-37-8
    Catalog No.: WLZ0917
    Purity: 95%
    MF: C11H17N5O5
    MW: 299.287
    Storage: 2-8 degree Celsius
    SMILES: NC=1NC(C=2N(CN(C2N1)[C@@H]1O[C@@H]([C@H]([C@H]1O)O)CO)C)=O
  3. 2',3'-dideoxyguanosine

    CAS No.: 85326-06-3
    Catalog No.: 178966
    Purity: 95%
    MF: C10H13N5O3
    MW: 251.246
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC2=C(N=CN2[C@H]2CC[C@@H](CO)O2)C(=O)N1
  4. 2'-Deoxy-5-hydroxymethyluridine

    CAS No.: 5116-24-5
    Catalog No.: WLZ0138
    Purity: 95%
    MF: C10H14N2O6
    MW: 258.23
    Storage: 2-8 degree Celsius
    SMILES: OCC=1C(NC(N([C@H]2C[C@H](O)[C@@H](CO)O2)C1)=O)=O
  5. N-(9-((2R,3R,4R,5S)-4-amino-3-fluoro-5-(hydroxymethyl)tetrahydrofuran-2-yl)-6-oxo-6,9-dihydro-1H-purin-2-yl)isobutyramide

    CAS No.: 2376756-52-2
    Catalog No.: WLZ0889
    Purity: 95%
    MF: C14H19FN6O4
    MW: 354.342
    Storage: 2-8 degree Celsius
    SMILES: N[C@H]1[C@H]([C@@H](O[C@@H]1CO)N1C=2N=C(NC(C2N=C1)=O)NC(C(C)C)=O)F
  6. 4-amino-1-((2R,3R,4R,5S)-4-amino-3-fluoro-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one

    CAS No.: NA
    Catalog No.: WLZ0890
    Purity: 95%
    MF: C9H13FN4O3
    MW: 244.226
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC(N(C=C1)[C@@H]1O[C@@H]([C@H]([C@H]1F)N)CO)=O
  7. 1-((2R,3R,4R,5S)-4-amino-3-fluoro-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione

    CAS No.: NA
    Catalog No.: WLZ0891
    Purity: 95%
    MF: C9H12FN3O4
    MW: 245.21
    Storage: 2-8 degree Celsius
    SMILES: N[C@H]1[C@H]([C@@H](O[C@@H]1CO)N1C(NC(C=C1)=O)=O)F
  8. 1-((3a'R,4'R,6'R,6a'S)-6'-(fluoromethyl)-6'-(hydroxymethyl)-3a'-methyltetrahydrospiro[cyclopentane-1,2'-furo[3,4-d][1,3]dioxol]-4'-yl)pyrimidine-2,4(1H,3H)-dione

    CAS No.: 1643585-09-4
    Catalog No.: WLZ0893
    Purity: 95%
    MF: C16H21FN2O6
    MW: 356.35
    Storage: 2-8 degree Celsius
    SMILES: FC[C@@]1(O[C@H]([C@]2([C@@H]1OC1(O2)CCCC1)C)N1C(NC(C=C1)=O)=O)CO
  9. 1-((2R,3R,4R,5S)-4-azido-3-hydroxy-5-(hydroxymethyl)-3-methyltetrahydrofuran-2-yl)-5-methylpyrimidine-2,4(1H,3H)-dione

    CAS No.: 215176-58-2
    Catalog No.: WLZ0894
    Purity: 95%
    MF: C11H15N5O5
    MW: 297.271
    Storage: 2-8 degree Celsius
    SMILES: N(=[N+]=[N-])[C@H]1[C@@]([C@@H](O[C@@H]1CO)N1C(NC(C(=C1)C)=O)=O)(C)O
  10. 2'-Deoxy-5'-O-TBDMS-5-Iodo-Uridine

    CAS No.: 134218-81-8
    Catalog No.: WLZ0903
    Purity: 95%
    MF: C15H25IN2O5Si
    MW: 468.364
    Storage: 2-8 degree Celsius
    SMILES: [Si](C)(C)(C(C)(C)C)OC[C@@H]1[C@H](C[C@@H](O1)N1C(NC(C(=C1)I)=O)=O)O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 33 total

  1. 1
  2. 2
  3. 3
  4. 4