•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Neuronal Signaling

Set Ascending Direction

   

Items 1 to 10 of 347 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. gamma-Secretase Modulators

    CAS No.: 937812-80-1
    Catalog No.: 100946
    Purity: 95%
    MF: C26H24F3N3O3
    MW: 483.49
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC\C(=C/C3=CC=C(N4C=NC(C)=C4)C(OC)=C3)C(=O)N1[C@@H](COC2)C1=CC(F)=C(F)C(F)=C1
  2. Lasmiditan

    CAS No.: 439239-90-4
    Catalog No.: 100654
    Purity: 95%
    MF: C19H18F3N3O2
    MW: 377.366
    Storage: 2-8 degree Celsius
    SMILES: CN1CCC(CC1)C(=O)C1=CC=CC(NC(=O)C2=C(F)C=C(F)C=C2F)=N1
  3. Alfuzosin HCl

    CAS No.: 81403-68-1
    Catalog No.: 101601
    Purity: 95%
    MF: C19H28ClN5O4
    MW: 425.917
    Storage: 2-8 degree Celsius
  4. Naratriptan hydrochloride

    CAS No.: 143388-64-1
    Catalog No.: 101566
    Purity: 95%
    MF: C17H26ClN3O2S
    MW: 371.934
    Storage: 2-8 degree Celsius
  5. Ticagrelor

    CAS No.: 274693-27-5
    Catalog No.: 101872
    Purity: 95%
    MF: C23H28F2N6O4S
    MW: 522.578
    Storage: 2-8 degree Celsius
  6. Fesoterodine Fumarate

    CAS No.: 286930-03-8
    Catalog No.: 102658
    Purity: 95%
    MF: C30H41NO7
    MW: 527.658
    Storage: 2-8 degree Celsius
  7. Iloperidone

    CAS No.: 133454-47-4
    Catalog No.: 102667
    Purity: 95%
    MF: C24H27FN2O4
    MW: 426.488
    Storage: 2-8 degree Celsius
  8. BRL-15572

    CAS No.: 193611-72-2
    Catalog No.: 104284
    Purity: 95%
    MF: C25H29Cl3N2O
    MW: 479.879
    Storage: 2-8 degree Celsius
  9. SB742457

    CAS No.: 607742-69-8
    Catalog No.: 104300
    Purity: 95%
    MF: C19H19N3O2S
    MW: 353.447
    Storage: 2-8 degree Celsius
  10. VU 0364770

    CAS No.: 61350-00-3
    Catalog No.: 104252
    Purity: 95%
    MF: C12H9ClN2O
    MW: 232.67
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 347 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5