•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Naphthalenes

Set Ascending Direction

   

Items 21 to 30 of 963 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-(dimethylamino)-1-(naphthalen-5-yl)propan-1-one

    CAS No.: 10320-49-7
    Catalog No.: 103133
    Purity: 95%
    MF: C15H17NO
    MW: 227.307
    Storage: 2-8 degree Celsius
    SMILES: CN(C)CCC(=O)C1=CC=CC2=CC=CC=C12
  2. ethyl-1,3-dihydroxy-2-naphtoate

    CAS No.: 6843-89-6
    Catalog No.: 103151
    Purity: 95%
    MF: C13H12O4
    MW: 232.235
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=C(O)C=C2C=CC=CC2=C1O
  3. pyren-1-ol

    CAS No.: 5315-79-7
    Catalog No.: 103168
    Purity: 95%
    MF: C16H10O
    MW: 218.255
    Storage: 2-8 degree Celsius
    SMILES: OC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2=C34
  4. 4-methoxy-1-naphthoic acid

    CAS No.: 13041-62-8
    Catalog No.: 103295
    Purity: 95%
    MF: C12H10O3
    MW: 202.209
    Storage: 2-8 degree Celsius
    SMILES: COC1=C2C=CC=CC2=C(C=C1)C(O)=O
  5. 2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol

    CAS No.: 68480-12-6
    Catalog No.: 103763
    Purity: 95%
    MF: C12H16O
    MW: 176.259
    Storage: 2-8 degree Celsius
  6. 7-amino-3,4-dihydronaphthalen-1(2H)-one

    CAS No.: 22009-40-1
    Catalog No.: 105047
    Purity: 95%
    MF: C10H11NO
    MW: 161.204
    Storage: 2-8 degree Celsius
  7. 3-(tert-butoxycarbonylamino)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid

    CAS No.: 903094-83-7
    Catalog No.: 105135
    Purity: 95%
    MF: C16H21NO4
    MW: 291.347
    Storage: 2-8 degree Celsius
  8. 1-(4-bromophenyl)naphthalene

    CAS No.: 204530-94-9
    Catalog No.: 105652
    Purity: 95%
    MF: C16H11Br
    MW: 283.168
    Storage: 2-8 degree Celsius
  9. 2-chloronaphthalene

    CAS No.: 91-58-7
    Catalog No.: 105717
    Purity: 95%
    MF: C10H7Cl
    MW: 162.619
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C=CC=CC2=C1
  10. 2,3-dihydroxynaphthalene-1,4-dicarbaldehyde

    CAS No.: 103860-60-2
    Catalog No.: 105788
    Purity: 95%
    MF: C12H8O4
    MW: 216.192
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 963 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5