•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Naphthalenes

Set Ascending Direction

   

Items 11 to 20 of 963 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-bromo-1,2,3,4-tetrahydronaphthalen-2-amine

    CAS No.: 167355-41-1
    Catalog No.: 101397
    Purity: 95%
    MF: C10H12BrN
    MW: 226.117
    Storage: 2-8 degree Celsius
    SMILES: NC1CCC2=C(C1)C=CC(Br)=C2
  2. 2-bromo-1-naphthol

    CAS No.: 771-15-3
    Catalog No.: 101541
    Purity: 95%
    MF: C10H7BrO
    MW: 223.069
    Storage: 2-8 degree Celsius
    SMILES: OC1=C2C=CC=CC2=CC=C1Br
  3. 1,1,4,4,6-pentamethyl-1,2,3,4-tetrahydronaphthalene

    CAS No.: 6683-48-3
    Catalog No.: 101750
    Purity: 95%
    MF: C15H22
    MW: 202.341
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(C=C1)C(C)(C)CCC2(C)C
  4. Bexarotene intermediate

    CAS No.: 153559-46-7
    Catalog No.: 101815
    Purity: 95%
    MF: C23H26O3
    MW: 350.458
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=C2C(=C1)C(C)(C)CCC2(C)C)C(=O)C1=CC=C(C=C1)C(O)=O
  5. 6-methoxynaphthalen-1-ol

    CAS No.: 22604-07-5
    Catalog No.: 102568
    Purity: 95%
    MF: C11H10O2
    MW: 174.199
    Storage: 2-8 degree Celsius
  6. 8-bromo-1-naphthoic acid

    CAS No.: 1729-99-3
    Catalog No.: 102594
    Purity: 95%
    MF: C11H7BrO2
    MW: 251.079
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=C2C(Br)=CC=CC2=CC=C1
  7. 1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride

    CAS No.: 1743-01-7
    Catalog No.: 102739
    Purity: 95%
    MF: C10H14ClN
    MW: 183.682
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].NC1CCC2=C(C1)C=CC=C2
  8. 8-amino-1-naphthoic acid

    CAS No.: 129-02-2
    Catalog No.: 102748
    Purity: 95%
    MF: C11H9NO2
    MW: 187.198
    Storage: 2-8 degree Celsius
  9. 4-methyl-1-naphthoic acid

    CAS No.: 4488-40-8
    Catalog No.: 102880
    Purity: 95%
    MF: C12H10O2
    MW: 186.21
    Storage: 2-8 degree Celsius
    SMILES: CC1=C2C=CC=CC2=C(C=C1)C(O)=O
  10. 2-chloro-7-methoxynaphthalene

    CAS No.: 67061-67-0
    Catalog No.: 102994
    Purity: 95%
    MF: C11H9ClO
    MW: 192.645
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 963 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5