•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Naphthalenes

Set Descending Direction

   

Items 1 to 10 of 963 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1-tert-butylnaphthalen-2-amine

    CAS No.: 389104-55-6
    Catalog No.: 100242
    Purity: 95%
    MF: C14H17N
    MW: 199.297
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=C2C=CC=CC2=CC=C1N
  2. 5-bromo-2-naphthoic acid

    CAS No.: 1013-83-8
    Catalog No.: 100243
    Purity: 95%
    MF: C11H7BrO2
    MW: 251.079
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C2C(Br)=CC=CC2=C1
  3. naphthalen-2-yl trifluoromethanesulfonate

    CAS No.: 3857-83-8
    Catalog No.: 100530
    Purity: 95%
    MF: C11H7F3O3S
    MW: 276.235
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)S(=O)(=O)OC1=CC=C2C=CC=CC2=C1
  4. N-(3-acetyl-7-methoxynaphthalen-1-yl)acetamide

    CAS No.: 871731-74-7
    Catalog No.: 100610
    Purity: 70%
    MF: C15H15NO3
    MW: 257.289
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(NC(C)=O)C=C(C=C2C=C1)C(C)=O
  5. tert-butyl acetyl(3-acetyl-7-methoxynaphthalen-1-yl)carbamate

    CAS No.: 871731-76-9
    Catalog No.: 100611
    Purity: 95%
    MF: C20H23NO5
    MW: 357.406
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=C(C=C2C=C1)C(C)=O)N(C(C)=O)C(=O)OC(C)(C)C
  6. 2-bromo-1-(naphthalen-1-yl)ethanone

    CAS No.: 13686-51-6
    Catalog No.: 100655
    Purity: 95%
    MF: C12H9BrO
    MW: 249.107
    Storage: 2-8 degree Celsius
    SMILES: BrCC(=O)C1=C2C=CC=CC2=CC=C1
  7. 2-(1-naphthoyl)malononitrile

    CAS No.: 1236038-48-4
    Catalog No.: 100669
    Purity: 95%
    MF: C14H8N2O
    MW: 220.231
    Storage: 2-8 degree Celsius
  8. 2-(methoxy(naphthalen-1-yl)methyl)malononitrile

    CAS No.: 1395492-78-0
    Catalog No.: 100670
    Purity: 95%
    MF: C15H12N2O
    MW: 236.274
    Storage: 2-8 degree Celsius
    SMILES: COC(C(C#N)C#N)C1=C2C=CC=CC2=CC=C1
  9. 8-(3,4-dihydroxy-4-methylpentyl)-3-isopropyl-7-methylnaphthalene-1,2-dione

    CAS No.: 240423-23-8
    Catalog No.: 101090
    Purity: 95%
    MF: C20H26O4
    MW: 330.424
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=CC2=C(C(=O)C1=O)C(CCC(O)C(C)(C)O)=C(C)C=C2
  10. 1-aminonaphthalene-2-carboxylic acid

    CAS No.: 4919-43-1
    Catalog No.: 101355
    Purity: 95%
    MF: C11H9NO2
    MW: 187.198
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C=CC=CC2=CC=C1C(O)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 963 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5