•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

mTOR

Set Ascending Direction

   

Items 21 to 28 of 28 total

  1. 1
  2. 2
  3. 3
  1. INK 128; MLN0128

    CAS No.: 1224844-38-5
    Catalog No.: 109776
    Purity: 95%
    MF: C15H15N7O
    MW: 309.333
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N1N=C(C2=C1N=CN=C2N)C1=CC=C2OC(N)=NC2=C1
  2. GDC-0349

    CAS No.: 1207360-89-1
    Catalog No.: 109849
    Purity: 95%
    MF: C24H32N6O3
    MW: 452.559
    Storage: 2-8 degree Celsius
  3. Rapamycin; Sirolimus

    CAS No.: 53123-88-9
    Catalog No.: 104788
    Purity: 95%
    MF: C51H79NO13
    MW: 914.187
    Storage: 2-8 degree Celsius
    SMILES: O=C1C([C@]2([C@@H](CC[C@@]([H])(C[C@@H](/C(=C/C=C/C=C/[C@H](C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(/C)=C/[C@@H](C)C(=O)C[C@@]([H])([C@H](C)C[C@@H]3CC[C@@H](O)[C@H](OC)C3)OC(=O)[C@@]([H])3CCCCN13)C)/C)OC)O2)C)O)=O
  4. Everolimus; RAD001

    CAS No.: 159351-69-6
    Catalog No.: 104899
    Purity: 95%
    MF: C54H85NO14
    MW: 972.267
    Storage: 2-8 degree Celsius
    SMILES: CO[C@@H]1C[C@H](C[C@H](C)[C@@H]2CC(=O)[C@H](C)\C=C(C)\[C@@H](O)[C@@H](OC)C(=O)[C@H](C)CC[C@H](C)\C=C\C=C\C=C(C)\[C@H](C[C@@H]3CC[C@@H](C)[C@@](O)(O3)C(=O)C(=O)N3CCCC[C@H]3C(=O)O2)OC)CC[C@H]1OCCO
  5. WYE-354

    CAS No.: 1062169-56-5
    Catalog No.: 104292
    Purity: 95%
    MF: C24H29N7O5
    MW: 495.54
    Storage: 2-8 degree Celsius
  6. Torin 2; Torin-2

    CAS No.: 1223001-51-1
    Catalog No.: 104390
    Purity: 95%
    MF: C24H15F3N4O
    MW: 432.405
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(C=N1)C1=CC=C2N=CC3=C(N(C(=O)C=C3)C3=CC=CC(=C3)C(F)(F)F)C2=C1
  7. AZD8055

    CAS No.: 1009298-09-2
    Catalog No.: 102703
    Purity: 95%
    MF: C25H31N5O4
    MW: 465.554
    Storage: 2-8 degree Celsius
  8. Vistusertib; AZD2014

    CAS No.: 1009298-59-2
    Catalog No.: 102702
    Purity: 95%
    MF: C25H30N6O3
    MW: 462.554
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)C1=CC=CC(=C1)C1=CC=C2C(N=C(N=C2N2CCOC[C@@H]2C)N2CCOC[C@@H]2C)=N1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 28 of 28 total

  1. 1
  2. 2
  3. 3