•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

mTOR

Set Ascending Direction

   

Items 1 to 10 of 28 total

  1. 1
  2. 2
  3. 3
  1. GNE-477

    CAS No.: 1032754-81-6
    Catalog No.: 112432
    Purity: 95%
    MF: C21H28N8O3S2
    MW: 504.642
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(CN2CCN(CC2)S(C)(=O)=O)SC2=C(N=C(N=C12)C1=CN=C(N)N=C1)N1CCOCC1
  2. NV-5138

    CAS No.: 2095886-80-7
    Catalog No.: 198912
    Purity: 95%
    MF: C7H13F2NO2
    MW: 181.182
    Storage: 2-8 degree Celsius
    SMILES: N[C@H](C(=O)O)CC(C(F)F)(C)C
  3. CZ415

    CAS No.: 1429639-50-8
    Catalog No.: 186204
    Purity: 95%
    MF: C22H29N5O4S
    MW: 459.572
    Storage: 2-8 degree Celsius
    SMILES: CC1(S(CC2=C1N=C(N=C2N2[C@H](COCC2)C)C2=CC=C(C=C2)NC(=O)NCC)(=O)=O)C
  4. GNE-493

    CAS No.: 1033735-94-2
    Catalog No.: 157218
    Purity: 95%
    MF: C17H20N6O2S
    MW: 372.454
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(O)C1=CC2=NC(=NC(N3CCOCC3)=C2S1)C1=CN=C(N)N=C1
  5. MHY1485

    CAS No.: 326914-06-1
    Catalog No.: 152094
    Purity: 95%
    MF: C17H21N7O4
    MW: 387.4
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC=C(NC2=NC(=NC(=N2)N2CCOCC2)N2CCOCC2)C=C1
  6. CC-223

    CAS No.: 1228013-30-6
    Catalog No.: 152111
    Purity: 95%
    MF: C21H27N5O3
    MW: 397.479
    Storage: 2-8 degree Celsius
    SMILES: CO[C@H]1CC[C@@H](CC1)N1C(=O)CNC2=NC=C(N=C12)C1=CC=C(N=C1)C(C)(C)O
  7. WYE-687

    CAS No.: 1062161-90-3
    Catalog No.: 141602
    Purity: 95%
    MF: C28H32N8O3
    MW: 528.617
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)NC1=CC=C(C=C1)C1=NC2=C(C=NN2C2CCN(CC3=CC=CN=C3)CC2)C(=N1)N1CCOCC1
  8. WAY-600

    CAS No.: 1062159-35-6
    Catalog No.: 141605
    Purity: 95%
    MF: C28H30N8O
    MW: 494.603
    Storage: 2-8 degree Celsius
    SMILES: C(N1CCC(CC1)N1N=CC2=C1N=C(N=C2N1CCOCC1)C1=CC=C2NC=CC2=C1)C1=CC=CN=C1
  9. Ridaforolimus; Deforolimus; MK-8669

    CAS No.: 572924-54-0
    Catalog No.: 141344
    Purity: 95%
    MF: C53H84NO14P
    MW: 990.222
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC[C@@H](C)[C@@](O)(O1)C(=O)C(=O)N1CCCC[C@@]1([H])C(=O)O[C@@]([H])(CC(=O)[C@H](C)\C=C(C)\[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)C=C\C=C\C=C(C)\[C@H](C2)OC)[C@H](C)C[C@@H]1CC[C@@H](OP(C)(C)=O)[C@@H](C1)OC
  10. Palomid 529; P529

    CAS No.: 914913-88-5
    Catalog No.: 140535
    Purity: 95%
    MF: C24H22O6
    MW: 406.434
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(COC2=C(OC)C=C3C(OC(=O)C4=CC(=CC=C34)C(C)O)=C2)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 28 total

  1. 1
  2. 2
  3. 3