•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Microbiology

Set Descending Direction

   

Items 1 to 10 of 38 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. ZK-756326

    CAS No.: 874911-96-3
    Catalog No.: 178305
    Purity: 95%
    MF: C21H28N2O3
    MW: 356.466
    Storage: 2-8 degree Celsius
    SMILES: OCCOCCN1CCN(CC2=CC=CC(OC3=CC=CC=C3)=C2)CC1
  2. Telbivudine

    CAS No.: 3424-98-4
    Catalog No.: 151478
    Purity: 95%
    MF: C10H14N2O5
    MW: 242.231
    Storage: 2-8 degree Celsius
    SMILES: CC1=CN([C@@H]2C[C@@H](O)[C@H](CO)O2)C(=O)NC1=O
  3. Abacavir sulfate

    CAS No.: 188062-50-2
    Catalog No.: 151831
    Purity: 95%
    MF: C28H38N12O6S
    MW: 670.757
    Storage: 2-8 degree Celsius
    SMILES: OS(O)(=O)=O.NC1=NC(NC2CC2)=C2N=CN([C@@H]3C[C@H](CO)C=C3)C2=N1.NC1=NC(NC2CC2)=C2N=CN([C@@H]3C[C@H](CO)C=C3)C2=N1
  4. Cabotegravir; GSK744; GSK1265744

    CAS No.: 1051375-10-0
    Catalog No.: 152080
    Purity: 95%
    MF: C19H17F2N3O5
    MW: 405.357
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CN3C=C(C(=O)NCC4=CC=C(F)C=C4F)C(=O)C(O)=C3C(=O)N1[C@@H](C)CO2
  5. Limonin

    CAS No.: 1180-71-8
    Catalog No.: 151628
    Purity: 95%
    MF: C26H30O8
    MW: 470.518
    Storage: 2-8 degree Celsius
    SMILES: [H][C@]12O[C@@]11[C@@](C)(CC[C@]3([H])[C@@]45COC(=O)C[C@]4([H])OC(C)(C)[C@]5([H])CC(=O)[C@@]13C)[C@@H](OC2=O)C1=COC=C1
  6. MK-2048

    CAS No.: 869901-69-9
    Catalog No.: 151767
    Purity: 95%
    MF: C21H21ClFN5O4
    MW: 461.881
    Storage: 2-8 degree Celsius
    SMILES: CCN1C[C@H](C)N2C(=C(O)C3=C2C(=NN(CC2=CC=C(F)C(Cl)=C2)C3=O)C(=O)NC)C1=O
  7. Dolutegravir Sodium; GSK-1349572A

    CAS No.: 1051375-19-9
    Catalog No.: 158439
    Purity: 95%
    MF: C20H18F2N3NaO5
    MW: 441.366
    Storage: 2-8 degree Celsius
    SMILES: [Na+].[H][C@]12CN3C=C(C(=O)NCC4=CC=C(F)C=C4F)C(=O)C([O-])=C3C(=O)N1[C@H](C)CCO2
  8. Capreomycin Sulfate

    CAS No.: 1405-37-4
    Catalog No.: 169588
    Purity: 95%
    MF: C50H88N28O15
    MW: 1321.435
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H]1NC(=O)[C@@H](N)CNC(=O)[C@@H](NC(=O)\C(NC(=O)[C@H](CNC(=O)C[C@@H](N)CCCN)NC1=O)=C/NC(N)=O)[C@H]1CCN=C(N)N1.NCCC[C@H](N)CC(=O)NC[C@@H]1NC(=O)[C@H](CO)NC(=O)[C@@H](N)CNC(=O)[C@@H](NC(=O)\C(NC1=O)=C/NC(N)=O)[C@H]1CCN=C(N)N1
  9. Ledipasvir acetone

    CAS No.: 1441674-54-9
    Catalog No.: 187349
    Purity: 95%
    MF: C52H60F2N8O7
    MW: 947.1
    Storage: 2-8 degree Celsius
    SMILES: C(OC)(=O)N[C@H](C(N1[C@H](C2NC(C3C=CC4C5=C(C(F)(F)C=4C=3)C=C(C3C=C4NC([C@@H]6[C@@]([H])7C[C@@]([H])(CC7)N6C(=O)[C@@H](NC(OC)=O)C(C)C)=NC4=CC=3)C=C5)=CN=2)CC2(CC2)C1)=O)C(C)C.CC(=O)C
  10. entecavir

    CAS No.: 142217-69-4
    Catalog No.: 158565
    Purity: 95%
    MF: C12H15N5O3
    MW: 277.284
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC2=C(N=CN2[C@H]2C[C@H](O)[C@@H](CO)C2=C)C(=O)N1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 38 total

  1. 1
  2. 2
  3. 3
  4. 4