•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Metabolism

Set Descending Direction

   

Items 1 to 10 of 207 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Bexarotene

    CAS No.: 153559-49-0
    Catalog No.: 101080
    Purity: 95%
    MF: C24H28O2
    MW: 348.486
    Storage: 2-8 degree Celsius
  2. Abiraterone

    CAS No.: 154229-19-3
    Catalog No.: 101144
    Purity: 95%
    MF: C24H31NO
    MW: 349.518
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC=C(C3=CC=CN=C3)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C
  3. Abiraterone Acetate

    CAS No.: 154229-18-2
    Catalog No.: 101149
    Purity: 95%
    MF: C26H33NO2
    MW: 391.555
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC=C(C3=CC=CN=C3)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@H](CC[C@]12C)OC(C)=O
  4. Tretinoin

    CAS No.: 302-79-4
    Catalog No.: 101084
    Purity: 95%
    MF: C20H28O2
    MW: 300.442
    Storage: 2-8 degree Celsius
    SMILES: C\C(\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C(/C)=C/C(O)=O
  5. Atorvastatin

    CAS No.: 134523-00-5
    Catalog No.: 101656
    Purity: 95%
    MF: C33H35FN2O5
    MW: 558.65
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=C(C(=O)NC2=CC=CC=C2)C(=C(N1CC[C@@H](O)C[C@@H](O)CC(O)=O)C1=CC=C(F)C=C1)C1=CC=CC=C1
  6. Atorvastatin Acetonide

    CAS No.: 581772-29-4
    Catalog No.: 101655
    Purity: 95%
    MF: C36H39FN2O5
    MW: 598.715
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=C(C(=O)NC2=CC=CC=C2)C(=C(N1CC[C@@H]1C[C@H](CC(O)=O)OC(C)(C)O1)C1=CC=C(F)C=C1)C1=CC=CC=C1
  7. GSK3787

    CAS No.: 188591-46-0
    Catalog No.: 101184
    Purity: 95%
    MF: C15H12ClF3N2O3S
    MW: 392.786
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CN=C(C=C1)S(=O)(=O)CCNC(=O)C1=CC=C(Cl)C=C1
  8. 4,5-dichlorobenzene-1,3-disulfonamide

    CAS No.: 120-97-8
    Catalog No.: 102631
    Purity: 95%
    MF: C6H6Cl2N2O4S2
    MW: 305.164
    Storage: 2-8 degree Celsius
  9. AGI-6780; AGI6780; AGI 6780

    CAS No.: 1432660-47-3
    Catalog No.: 104342
    Purity: 95%
    MF: C21H18F3N3O3S2
    MW: 481.521
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CC(NC(=O)NC2=CC(=CC=C2C2=CSC=C2)S(=O)(=O)NC2CC2)=CC=C1
  10. Cobicistat; GS-9350

    CAS No.: 1004316-88-4
    Catalog No.: 104176
    Purity: 95%
    MF: C40H53N7O5S2
    MW: 776.042
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 207 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5