•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Metabolic Enzyme/Protease

Set Ascending Direction

   

Items 31 to 40 of 173 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. Roflumilast N-oxide

    CAS No.: 292135-78-5
    Catalog No.: 185398
    Purity: 95%
    MF: C17H14Cl2F2N2O4
    MW: 419.211
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=[N+](C=C(C1NC(C1=CC(=C(C=C1)OC(F)F)OCC1CC1)=O)Cl)[O-]
  2. Capzimin

    CAS No.: 2084867-65-0
    Catalog No.: 185596
    Purity: 95%
    MF: C15H13N3OS2
    MW: 315.423
    Storage: 2-8 degree Celsius
    SMILES: SC=1C=CC=C2C=C(C=NC12)C(=O)NCCC=1SC=CN1
  3. PD150606

    CAS No.: 179528-45-1
    Catalog No.: 186195
    Purity: 95%
    MF: C9H7IO2S
    MW: 306.124
    Storage: 2-8 degree Celsius
    SMILES: IC1=CC=C(C=C1)\C=C(\C(=O)O)/S
  4. KML-29

    CAS No.: 1380424-42-9
    Catalog No.: 186209
    Purity: 95%
    MF: C24H21F6NO7
    MW: 549.42
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)C(C2CCN(CC2)C(=O)OC(C(F)(F)F)C(F)(F)F)(O)C2=CC1=C(OCO1)C=C2
  5. BIA 10-2474

    CAS No.: 1233855-46-3
    Catalog No.: 186246
    Purity: 95%
    MF: C16H20N4O2
    MW: 300.362
    Storage: 2-8 degree Celsius
    SMILES: C1(CCCCC1)N(C(=O)N1C=NC(=C1)C=1C=[N+](C=CC1)[O-])C
  6. 2-PMPA

    CAS No.: 173039-10-6
    Catalog No.: 186248
    Purity: 95%
    MF: C6H11O7P
    MW: 226.121
    Storage: 2-8 degree Celsius
    SMILES: P(=O)(O)(O)CC(C(=O)O)CCC(=O)O
  7. PF05175157

    CAS No.: 1301214-47-0
    Catalog No.: 186266
    Purity: 95%
    MF: C23H27N5O2
    MW: 405.502
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)N1N=CC=2CC3(CCN(CC3)C(=O)C=3C=CC4=C(NC(=N4)C)C3)CC(C12)=O
  8. PF-06282999

    CAS No.: 1435467-37-0
    Catalog No.: 186282
    Purity: 95%
    MF: C13H12ClN3O3S
    MW: 325.777
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC(=C(C1)C1=CC(NC(N1CC(=O)N)=S)=O)OC
  9. TM5275 sodium

    CAS No.: 1103926-82-4
    Catalog No.: 186296
    Purity: 95%
    MF: C28H27ClN3NaO5
    MW: 543.983
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)(C1=CC=CC=C1)N1CCN(CC1)C(COCC(=O)NC1=C(C(=O)[O-])C=C(C=C1)Cl)=O.[Na+]
  10. E6005

    CAS No.: 947620-48-6
    Catalog No.: 186299
    Purity: 95%
    MF: C26H24N4O5
    MW: 472.501
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=C2C(=NC(=NC2=CC1OC)NC)C=1C=C(C=CC1)NC(=O)C1=CC=C(C(=O)OC)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 173 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6