•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Membrane Transporter/Ion Channel

Set Ascending Direction

   

Items 21 to 28 of 28 total

  1. 1
  2. 2
  3. 3
  1. Atracurium Besylate

    CAS No.: 64228-81-5
    Catalog No.: 151514
    Purity: 95%
    MF: C65H82N2O18S2
    MW: 1243.501
    Storage: 2-8 degree Celsius
    SMILES: [O-]S(=O)(=O)C1=CC=CC=C1.[O-]S(=O)(=O)C1=CC=CC=C1.COC1=CC=C(CC2C3=C(CC[N+]2(C)CCC(=O)OCCCCCOC(=O)CC[N+]2(C)CCC4=C(C=C(OC)C(OC)=C4)C2CC2=CC=C(OC)C(OC)=C2)C=C(OC)C(OC)=C3)C=C1OC
  2. Indapamide

    CAS No.: 26807-65-8
    Catalog No.: 141157
    Purity: 95%
    MF: C16H16ClN3O3S
    MW: 365.842
    Storage: 2-8 degree Celsius
    SMILES: CC1CC2=CC=CC=C2N1NC(=O)C1=CC(=C(Cl)C=C1)S(N)(=O)=O
  3. Ampalex

    CAS No.: 154235-83-3
    Catalog No.: 108907
    Purity: 95%
    MF: C14H15N3O
    MW: 241.294
    Storage: 2-8 degree Celsius
    SMILES: O=C(N1CCCCC1)C1=CC=C2N=CC=NC2=C1
  4. TRPM8 antagonist 2

    CAS No.: 259674-19-6
    Catalog No.: TQR1202
    Purity: 95%
    MF: C26H26N2O2
    MW: 398.506
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N([C@H](C(=O)OC)CC1=CNC2=CC=CC=C12)CC1=CC=CC=C1
  5. Tetrabenazine

    CAS No.: 58-46-8
    Catalog No.: LT0145
    Purity: 95%
    MF: C19H27NO3
    MW: 317.429
    Storage: 2-8 degree Celsius
    SMILES: C(C(C)C)[C@@H]1C(C[C@@H]2N(CCC3=CC(=C(C=C23)OC)OC)C1)=O
  6. Azimilide Dihydrochloride

    CAS No.: 149888-94-8
    Catalog No.: 194235
    Purity: 95%
    MF: C23H30Cl3N5O3
    MW: 530.884
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.ClC1=CC=C(C=C1)C1=CC=C(O1)\C=N\N1C(N(C(C1)=O)CCCCN1CCN(CC1)C)=O
  7. Azimilide

    CAS No.: 149908-53-2
    Catalog No.: 194234
    Purity: 95%
    MF: C23H28ClN5O3
    MW: 457.962
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C1=CC=C(O1)\C=N\N1C(N(C(C1)=O)CCCCN1CCN(CC1)C)=O
  8. DL-AP5

    CAS No.: 76326-31-3
    Catalog No.: 193699
    Purity: 95%
    MF: C5H12NO5P
    MW: 197.127
    Storage: 2-8 degree Celsius
    SMILES: NC(C(=O)O)CCCP(=O)(O)O
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 28 of 28 total

  1. 1
  2. 2
  3. 3