•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

MAPK

Set Descending Direction

   

Items 1 to 10 of 127 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Pimasertib; AS-703026; AS 703026; AS703026

    CAS No.: 1236699-92-5
    Catalog No.: 100330
    Purity: 95%
    MF: C15H15FIN3O3
    MW: 431.205
    Storage: 2-8 degree Celsius
    SMILES: OC[C@@H](O)CNC(=O)C1=CC=NC=C1NC1=CC=C(I)C=C1F
  2. Cobimetinib; GDC-0973; RG7420

    CAS No.: 934660-93-2
    Catalog No.: 100636
    Purity: 95%
    MF: C21H21F3IN3O2
    MW: 531.316
    Storage: 2-8 degree Celsius
    SMILES: OC1(CN(C1)C(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F)[C@@H]1CCCCN1
  3. Sorafenib; Nexavar

    CAS No.: 284461-73-0
    Catalog No.: 101007
    Purity: 95%
    MF: C21H16ClF3N4O3
    MW: 464.831
    Storage: 2-8 degree Celsius
    SMILES: CNC(=O)C1=NC=CC(OC2=CC=C(NC(=O)NC3=CC=C(Cl)C(=C3)C(F)(F)F)C=C2)=C1
  4. Trametinib; GSK1120212; GSK-1120212

    CAS No.: 871700-17-3
    Catalog No.: 100836
    Purity: 95%
    MF: C26H23FIN5O4
    MW: 615.403
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=O)C(C)=C2N(C(=O)N(C3CC3)C(=O)C2=C1NC1=CC=C(I)C=C1F)C1=CC(NC(C)=O)=CC=C1
  5. CEP-32496 hydrochloride

    CAS No.: 1227678-26-3
    Catalog No.: 100854
    Purity: 95%
    MF: C24H23ClF3N5O5
    MW: 553.925
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].COC1=CC2=NC=NC(OC3=CC(NC(=O)NC4=NOC(=C4)C(C)(C)C(F)(F)F)=CC=C3)=C2C=C1OC
  6. Dabrafenib; GSK2118436

    CAS No.: 1195765-45-7
    Catalog No.: 101094
    Purity: 95%
    MF: C23H20F3N5O2S2
    MW: 519.574
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=NC(=C(S1)C1=NC(N)=NC=C1)C1=C(F)C(NS(=O)(=O)C2=C(F)C=CC=C2F)=CC=C1
  7. Binimetinib; MEK162; ARRY-162; ARRY-438162

    CAS No.: 606143-89-9
    Catalog No.: 101175
    Purity: 95%
    MF: C17H15BrF2N4O3
    MW: 441.232
    Storage: 2-8 degree Celsius
  8. VX-745

    CAS No.: 209410-46-8
    Catalog No.: 101973
    Purity: 95%
    MF: C19H9Cl2F2N3OS
    MW: 436.27
    Storage: 2-8 degree Celsius
  9. Vemurafenib; PLX4032; RG7204; PLX-4032; R7204; RO5185426

    CAS No.: 918504-65-1
    Catalog No.: 104532
    Purity: 95%
    MF: C23H18ClF2N3O3S
    MW: 489.931
    Storage: 2-8 degree Celsius
    SMILES: CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C2=CNC3=NC=C(C=C23)C2=CC=C(Cl)C=C2)=C1F
  10. MEK inhibitor

    CAS No.: 334951-92-7
    Catalog No.: 104279
    Purity: 95%
    MF: C26H26N4O2
    MW: 426.52
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 127 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5