•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

JAK

Set Descending Direction

   

Items 1 to 10 of 45 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Solcitinib

    CAS No.: 1206163-45-2
    Catalog No.: 157321
    Purity: 95%
    MF: C22H23N5O2
    MW: 389.459
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)CN(C1)C(=O)C1=CC=C(C=C1)C1=CC=CC2=NC(NC(=O)C3CC3)=NN12
  2. Peficitinb; ASP015K; JNJ-54781532

    CAS No.: 944118-01-8
    Catalog No.: 152054
    Purity: 95%
    MF: C18H22N4O2
    MW: 326.4
    Storage: 2-8 degree Celsius
    SMILES: NC(=O)C1=C(N[C@@H]2[C@H]3C[C@H]4C[C@@H]2C[C@](O)(C4)C3)C2=C(NC=C2)N=C1
  3. ZM 39923 HCl

    CAS No.: 1021868-92-7
    Catalog No.: 152147
    Purity: 95%
    MF: C23H26ClNO
    MW: 367.92
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC(C)N(CCC(=O)C1=CC2=CC=CC=C2C=C1)CC1=CC=CC=C1
  4. S-Ruxolitinib; INCB018424

    CAS No.: 941685-37-6
    Catalog No.: 150957
    Purity: 95%
    MF: C17H18N6
    MW: 306.373
    Storage: 2-8 degree Celsius
    SMILES: N#CC[C@@H](C1CCCC1)N1C=C(C=N1)C1=NC=NC2=C1C=CN2
  5. C188-9

    CAS No.: 432001-19-9
    Catalog No.: 186827
    Purity: 95%
    MF: C27H21NO5S
    MW: 471.534
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=C(C2=CC=CC=C12)NS(=O)(=O)C1=CC=C(C=C1)OC)C1=C(C=CC2=CC=CC=C12)O
  6. Deucravacitinib (BMS-986165)

    CAS No.: 1609392-27-9
    Catalog No.: 193640
    Purity: 95%
    MF: C20H22N8O3
    MW: 422.449
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C(=O)NC1=CC(=C(N=N1)C(=O)NC)NC1=C(C(=CC=C1)C1=NN(C=N1)C)OC
  7. Abrocitinib

    CAS No.: 1622902-68-4
    Catalog No.: ZB1566
    Purity: 95%
    MF: C14H21N5O2S
    MW: 323.41
    Storage: 2-8 degree Celsius
    SMILES: CCCS(=O)(N[C@H]1C[C@@H](N(C)C2=C3C(NC=C3)=NC=N2)C1)=O
  8. Decernotinib; VX-509

    CAS No.: 944842-54-0
    Catalog No.: 150958
    Purity: 95%
    MF: C18H19F3N6O
    MW: 392.385
    Storage: 2-8 degree Celsius
    SMILES: CC[C@@](C)(NC1=CC=NC(=N1)C1=CNC2=C1C=CC=N2)C(=O)NCC(F)(F)F
  9. Upadacitinib; ABT-494

    CAS No.: 1310726-60-3
    Catalog No.: 183282
    Purity: 95%
    MF: C17H19F3N6O
    MW: 380.374
    Storage: 2-8 degree Celsius
    SMILES: CC[C@@H]1CN(C[C@@H]1C1=CN=C2C=NC3=C(C=CN3)N12)C(=O)NCC(F)(F)F
  10. FM-381

    CAS No.: 2226521-65-7
    Catalog No.: TQR1213
    Purity: 95%
    MF: C24H24N6O2
    MW: 428.496
    Storage: 2-8 degree Celsius
    SMILES: C(#N)/C(/C(=O)N(C)C)=C\C=1OC(=CC1)C1=NC=2C(=C3C(=NC2)NC=C3)N1C1CCCCC1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 45 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5