•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

JAK/STAT

Set Descending Direction

   

Items 1 to 10 of 98 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. AZ 7550

    CAS No.: 1421373-99-0
    Catalog No.: 190807
    Purity: 95%
    MF: C27H31N7O2
    MW: 485.592
    Storage: 2-8 degree Celsius
    SMILES: CN(CCNC)C1=C(C=C(C(=C1)OC)NC1=NC=CC(=N1)C1=CN(C2=CC=CC=C12)C)NC(C=C)=O
  2. Baricitinib trifluoroacetate

    CAS No.: 1187594-10-0
    Catalog No.: 180923
    Purity: 95%
    MF: C18H17F3N7O4S-
    MW: 484.44
    Storage: 2-8 degree Celsius
    SMILES: [O-]C(=O)C(F)(F)F.CCS(=O)(=O)N1CC(CC#N)(C1)N1C=C(C=N1)C1=NC=NC2=C1C=CN2
  3. Pim1/AKK1-IN-1

    CAS No.: 1093222-27-5
    Catalog No.: 178722
    Purity: 95%
    MF: C20H13N5O
    MW: 339.358
    Storage: 2-8 degree Celsius
    SMILES: O=C(NC1=CNC2=C1C=C(C=N2)C1=CC=C(C=C1)C#N)C1=CC=CN=C1
  4. FLLL32

    CAS No.: 1226895-15-3
    Catalog No.: 169619
    Purity: 95%
    MF: C28H32O6
    MW: 464.558
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OC)C=C(C=CC(=O)C2(CCCCC2)C(=O)C=CC2=CC(OC)=C(OC)C=C2)C=C1
  5. TCS-PIM-1-4a

    CAS No.: 327033-36-3
    Catalog No.: 169518
    Purity: 95%
    MF: C11H6F3NO2S
    MW: 273.235
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=CC=CC(C=C2SC(=O)NC2=O)=C1
  6. AV-412 Tosylate

    CAS No.: 451493-31-5
    Catalog No.: 169508
    Purity: 95%
    MF: C41H42ClFN6O7S2-2
    MW: 849.407
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1)S([O-])(=O)=O.CC1=CC=C(C=C1)S([O-])(=O)=O.CN1CCN(CC1)C(C)(C)C#CC1=C(NC(=O)C=C)C=C2C(NC3=CC(Cl)=C(F)C=C3)=NC=NC2=C1
  7. Solcitinib

    CAS No.: 1206163-45-2
    Catalog No.: 157321
    Purity: 95%
    MF: C22H23N5O2
    MW: 389.459
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)CN(C1)C(=O)C1=CC=C(C=C1)C1=CC=CC2=NC(NC(=O)C3CC3)=NN12
  8. TCS PIM-1 1

    CAS No.: 491871-58-0
    Catalog No.: 157227
    Purity: 95%
    MF: C18H11BrN2O2
    MW: 367.202
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=C(Br)C=C1)C1=CC(C2=CC=CC=C2)=C(C#N)C(=O)N1
  9. Cerdulatinib(PRT-062070; PRT2070)

    CAS No.: 1198300-79-6
    Catalog No.: 157204
    Purity: 95%
    MF: C20H27N7O3S
    MW: 445.549
    Storage: 2-8 degree Celsius
    SMILES: CCS(=O)(=O)N1CCN(CC1)C1=CC=C(NC2=NC(NC3CC3)=C(C=N2)C(N)=O)C=C1
  10. Icotinib HCl

    CAS No.: 1204313-51-8
    Catalog No.: 157183
    Purity: 95%
    MF: C22H22ClN3O4
    MW: 427.888
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].C#CC1=CC(NC2=C3C=C4OCCOCCOCCOC4=CC3=NC=N2)=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 98 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5