•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Isothiazoles

Set Ascending Direction

   

Items 11 to 20 of 74 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-methyl-5-nitroisothiazole

    CAS No.: 36778-16-2
    Catalog No.: TQR0287
    Purity: 95%
    MF: C4H4N2O2S
    MW: 144.155
    Storage: 2-8 degree Celsius
    SMILES: CC1=NSC(=C1)[N+](=O)[O-]
  2. 4-methyl-isothiazole-5-carbaldehyde

    CAS No.: 88511-33-5
    Catalog No.: 163247
    Purity: 95%
    MF: C5H5NOS
    MW: 127.168
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SN=C1)C=O
  3. 5-bromo-4-methyl-isothiazole

    CAS No.: 503427-04-1
    Catalog No.: 162967
    Purity: 95%
    MF: C4H4BrNS
    MW: 178.054
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(Br)SN=C1
  4. 5-bromo-isothiazole

    CAS No.: 54390-97-5
    Catalog No.: 162941
    Purity: 95%
    MF: C3H2BrNS
    MW: 164.027
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=NS1
  5. 5-chloro-3-methyl-isothiazole

    CAS No.: 20067-16-7
    Catalog No.: 162914
    Purity: 95%
    MF: C4H4ClNS
    MW: 133.603
    Storage: 2-8 degree Celsius
    SMILES: CC1=NSC(Cl)=C1
  6. 5-methyl-isothiazole-3-carboxylic acid

    CAS No.: 110632-59-2
    Catalog No.: 162817
    Purity: 95%
    MF: C5H5NO2S
    MW: 143.167
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC(=NS1)C(O)=O
  7. 5-iodo-3-methylisothiazole-4-carboxylic acid

    CAS No.: 1383546-18-6
    Catalog No.: 159071
    Purity: 95%
    MF: C5H4INO2S
    MW: 269.063
    Storage: 2-8 degree Celsius
    SMILES: CC1=NSC(I)=C1C(O)=O
  8. 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isothiazole

    CAS No.: 1251459-71-8
    Catalog No.: 187555
    Purity: 95%
    MF: C9H14BNO2S
    MW: 211.095
    Storage: 2-8 degree Celsius
    SMILES: CC1(OB(OC1(C)C)C=1C=NSC1)C
  9. isothiazol-4-ylboronic acid hydrochloride

    CAS No.: NA
    Catalog No.: 187531
    Purity: 95%
    MF: C3H5BClNO2S
    MW: 165.41
    Storage: 2-8 degree Celsius
    SMILES: S1C=C(B(O)O)C=N1.[H]Cl
  10. methyl isothiazole-4-carboxylate

    CAS No.: 56133-37-0
    Catalog No.: 150106
    Purity: 95%
    MF: C5H5NO2S
    MW: 143.167
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CSN=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 74 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5