•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Isoquinolines

Set Ascending Direction

   

Items 61 to 70 of 1171 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 4-bromo-1-chloroisoquinoline

    CAS No.: 66728-98-1
    Catalog No.: 105611
    Purity: 95%
    MF: C9H5BrClN
    MW: 242.503
    Storage: 2-8 degree Celsius
  2. 4-bromo-5-nitroisoquinoline

    CAS No.: 58142-46-4
    Catalog No.: 105645
    Purity: 95%
    MF: C9H5BrN2O2
    MW: 253.055
    Storage: 2-8 degree Celsius
  3. 5-bromo-1,2,3,4-tetrahydroisoquinoline

    CAS No.: 81237-69-6
    Catalog No.: 105663
    Purity: 95%
    MF: C9H10BrN
    MW: 212.09
    Storage: 2-8 degree Celsius
  4. 1,2,3,4-tetrahydroisoquinoline-7-carbonitrile

    CAS No.: 149355-52-2
    Catalog No.: 105744
    Purity: 95%
    MF: C10H10N2
    MW: 158.204
    Storage: 2-8 degree Celsius
  5. 4,4-dimethyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

    CAS No.: 41565-86-0
    Catalog No.: 105809
    Purity: 95%
    MF: C11H16ClN
    MW: 197.709
    Storage: 2-8 degree Celsius
  6. 6-fluoroisoquinoline

    CAS No.: 1075-11-2
    Catalog No.: 105872
    Purity: 95%
    MF: C9H6FN
    MW: 147.152
    Storage: 2-8 degree Celsius
  7. 4-fluoroisoquinoline

    CAS No.: 394-67-2
    Catalog No.: 105873
    Purity: 95%
    MF: C9H6FN
    MW: 147.152
    Storage: 2-8 degree Celsius
    SMILES: FC1=CN=CC2=C1C=CC=C2
  8. 6-fluoro-1,2,3,4-tetrahydroisoquinoline

    CAS No.: 224161-37-9
    Catalog No.: 105887
    Purity: 95%
    MF: C9H10FN
    MW: 151.184
    Storage: 2-8 degree Celsius
  9. 1,2,3,4-tetrahydroisoquinolin-6-ol

    CAS No.: 14446-24-3
    Catalog No.: 105941
    Purity: 95%
    MF: C9H11NO
    MW: 149.193
    Storage: 2-8 degree Celsius
  10. 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid

    CAS No.: 76824-99-2
    Catalog No.: 105942
    Purity: 95%
    MF: C10H11NO3
    MW: 193.202
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1CC2=C(CN1)C=CC(O)=C2
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 1171 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9