•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Isoquinolines

Set Descending Direction

   

Items 1 to 10 of 1171 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-methylisoquinolin-1(2H)-one

    CAS No.: 4594-71-2
    Catalog No.: 100238
    Purity: 95%
    MF: C10H9NO
    MW: 159.188
    Storage: 2-8 degree Celsius
    SMILES: CN1C=CC2=C(C=CC=C2)C1=O
  2. 2-methyl-4-nitroisoquinolin-1(2H)-one

    CAS No.: 33930-79-9
    Catalog No.: 100239
    Purity: 95%
    MF: C10H8N2O3
    MW: 204.185
    Storage: 2-8 degree Celsius
    SMILES: CN1C=C(C2=C(C=CC=C2)C1=O)[N+]([O-])=O
  3. isoquinolin-1(2H)-one

    CAS No.: 491-30-5
    Catalog No.: 100240
    Purity: 95%
    MF: C9H7NO
    MW: 145.161
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC=CC2=C1C=CC=C2
  4. 6-bromoisoquinoline

    CAS No.: 34784-05-9
    Catalog No.: 101491
    Purity: 95%
    MF: C9H6BrN
    MW: 208.058
    Storage: 2-8 degree Celsius
  5. 7,8-dihydroisoquinolin-5(6H)-one

    CAS No.: 21917-86-2
    Catalog No.: 101993
    Purity: 95%
    MF: C9H9NO
    MW: 147.177
    Storage: 2-8 degree Celsius
  6. 4-bromo-7-chloroisoquinoline

    CAS No.: 953421-72-2
    Catalog No.: 102468
    Purity: 95%
    MF: C9H5BrClN
    MW: 242.503
    Storage: 2-8 degree Celsius
  7. 3-isoquinolinecarboxaldehyde

    CAS No.: 5470-80-4
    Catalog No.: 102842
    Purity: 95%
    MF: C10H7NO
    MW: 157.172
    Storage: 2-8 degree Celsius
  8. 7-bromoisoquinolin-1-amine

    CAS No.: 215453-53-5
    Catalog No.: 102946
    Purity: 95%
    MF: C9H7BrN2
    MW: 223.073
    Storage: 2-8 degree Celsius
  9. isoquinoline-5-carboxylic acid

    CAS No.: 27810-64-6
    Catalog No.: 103118
    Purity: 95%
    MF: C10H7NO2
    MW: 173.171
    Storage: 2-8 degree Celsius
  10. 8-methoxy-1,2,3,4-tetrahydroisoquinoline

    CAS No.: 34146-68-4
    Catalog No.: 103343
    Purity: 95%
    MF: C10H13NO
    MW: 163.22
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 1171 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5