•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Isoindolines

Set Descending Direction

   

Items 1 to 10 of 626 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-(1-(4-bromophenyl)-3-oxocyclobutyl)isoindoline-1,3-dione

    CAS No.: 1199556-87-0
    Catalog No.: 100142
    Purity: 95%
    MF: C18H12BrNO3
    MW: 370.202
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1(CC(=O)C1)N1C(=O)C2=C(C=CC=C2)C1=O
  2. 6-(aminomethyl)isoindolin-1-one

    CAS No.: 1251195-14-8
    Catalog No.: 100174
    Purity: 95%
    MF: C9H10N2O
    MW: 162.192
    Storage: 2-8 degree Celsius
    SMILES: NCC1=CC2=C(CNC2=O)C=C1
  3. 2-(3-(isopropylamino)propyl)isoindoline-1,3-dione

    CAS No.: 403998-13-0
    Catalog No.: 100600
    Purity: 95%
    MF: C14H18N2O2
    MW: 246.31
    Storage: 2-8 degree Celsius
    SMILES: CC(C)NCCCN1C(=O)C2=C(C=CC=C2)C1=O
  4. tert-butyl 3-(1,3-dioxoisoindolin-2-yl)propyl(isopropyl)carbamate

    CAS No.: 1395492-52-0
    Catalog No.: 100601
    Purity: 95%
    MF: C19H26N2O4
    MW: 346.427
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N(CCCN1C(=O)C2=C(C=CC=C2)C1=O)C(=O)OC(C)(C)C
  5. 2-(2-(vinyloxy)ethoxy)isoindoline-1,3-dione

    CAS No.: 391212-30-9
    Catalog No.: 100648
    Purity: 95%
    MF: C12H11NO4
    MW: 233.223
    Storage: 2-8 degree Celsius
    SMILES: C=COCCON1C(=O)C2=C(C=CC=C2)C1=O
  6. 2-((1R,3R)-1-(4-bromophenyl)-3-hydroxy-3-methylcyclobutyl)isoindoline-1,3-dione

    CAS No.: 1422057-36-0
    Catalog No.: 100695
    Purity: 95%
    MF: C19H16BrNO3
    MW: 386.245
    Storage: 2-8 degree Celsius
  7. 2-((1R,3R)-3-hydroxy-3-methyl-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclobutyl)isoindoline-1,3-dione

    CAS No.: 1199556-90-5
    Catalog No.: 100696
    Purity: 95%
    MF: C25H28BNO5
    MW: 433.313
    Storage: 2-8 degree Celsius
  8. 5-fluoroisoindolin-1-one

    CAS No.: 1260666-80-5
    Catalog No.: 100701
    Purity: 95%
    MF: C8H6FNO
    MW: 151.14
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(C=C1)C(=O)NC2
  9. 2-((3-chloropyrazin-2-yl)methyl)isoindoline-1,3-dione

    CAS No.: 867165-55-7
    Catalog No.: 100789
    Purity: 95%
    MF: C13H8ClN3O2
    MW: 273.679
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CN=C1CN1C(=O)C2=C(C=CC=C2)C1=O
  10. 6-(aminomethyl)isoindolin-1-one hydrochloride

    CAS No.: 1250443-39-0
    Catalog No.: 101194
    Purity: 95%
    MF: C9H11ClN2O
    MW: 198.653
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].NCC1=CC2=C(CNC2=O)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 626 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5