•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indolines

Set Descending Direction

   

Items 1 to 10 of 282 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-bromo-7-fluoroindoline-2,3-dione

    CAS No.: 1153535-26-2
    Catalog No.: 100173
    Purity: 95%
    MF: C8H3BrFNO2
    MW: 244.019
    Storage: 2-8 degree Celsius
  2. methyl 2-oxoindoline-6-carboxylate

    CAS No.: 14192-26-8
    Catalog No.: 100175
    Purity: 95%
    MF: C10H9NO3
    MW: 191.186
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC2=C(CC(=O)N2)C=C1
  3. 1-acetylindolin-2-one

    CAS No.: 21905-78-2
    Catalog No.: 100735
    Purity: 95%
    MF: C10H9NO2
    MW: 175.187
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)N1C(=O)CC2=C1C=CC=C2
  4. 1-acetyl-5-nitroindolin-2-one

    CAS No.: 114985-63-6
    Catalog No.: 100736
    Purity: 95%
    MF: C10H8N2O4
    MW: 220.184
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)N1C(=O)CC2=C1C=CC(=C2)[N+]([O-])=O
  5. 1-acetyl-5-aminoindolin-2-one

    CAS No.: 422518-10-3
    Catalog No.: 100737
    Purity: 95%
    MF: C10H10N2O2
    MW: 190.202
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)N1C(=O)CC2=C1C=CC(N)=C2
  6. N-(1-acetyl-2-oxoindolin-5-yl)ethanesulfonamide

    CAS No.: 1407180-81-7
    Catalog No.: 100738
    Purity: 95%
    MF: C12H14N2O4S
    MW: 282.321
    Storage: 2-8 degree Celsius
    SMILES: CCS(=O)(=O)NC1=CC2=C(C=C1)N(C(C)=O)C(=O)C2
  7. methyl 1-acetyl-2-oxoindoline-6-carboxylate

    CAS No.: 676326-36-6
    Catalog No.: 101043
    Purity: 95%
    MF: C12H11NO4
    MW: 233.223
    Storage: 2-8 degree Celsius
  8. 2,3-dioxoindoline-5-sulfonyl chloride

    CAS No.: 132898-96-5
    Catalog No.: 101284
    Purity: 95%
    MF: C8H4ClNO4S
    MW: 245.643
    Storage: 2-8 degree Celsius
    SMILES: ClS(=O)(=O)C1=CC2=C(NC(=O)C2=O)C=C1
  9. (Z)-3-(4-methyl-2-((2-oxoindolin-3-ylidene)methyl)-1H-pyrrol-3-yl)propanoic acid

    CAS No.: 215543-92-3
    Catalog No.: 101777
    Purity: 95%
    MF: C17H16N2O3
    MW: 296.326
    Storage: 2-8 degree Celsius
  10. 3-(piperidin-4-yl)indolin-2-one

    CAS No.: 72831-89-1
    Catalog No.: 102359
    Purity: 95%
    MF: C13H16N2O
    MW: 216.284
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC2=C(C=CC=C2)C1C1CCNCC1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 282 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5