•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indoles

Set Ascending Direction

   

Items 31 to 40 of 768 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. methyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate

    CAS No.: 494799-19-8
    Catalog No.: TQP0845
    Purity: 95%
    MF: C16H18BrNO2
    MW: 336.229
    Storage: 2-8 degree Celsius
    SMILES: BrC=1NC2=CC(=CC=C2C1C1CCCCC1)C(=O)OC
  2. 5-(1H-indol-6-yl)-1H-pyrazol-3-amine

    CAS No.: 2377407-37-7
    Catalog No.: TQR0086
    Purity: 95%
    MF: C11H10N4
    MW: 198.229
    Storage: 2-8 degree Celsius
    SMILES: N1C=CC2=CC=C(C=C12)C1=CC(=NN1)N
  3. 3-amino-5-(1H-indol-6-yl)-1H-pyrazole-4-carbonitrile

    CAS No.: 2374732-92-8
    Catalog No.: TQR0087
    Purity: 95%
    MF: C12H9N5
    MW: 223.239
    Storage: 2-8 degree Celsius
    SMILES: NC1=NNC(=C1C#N)C1=CC=C2C=CNC2=C1
  4. 4',9'-dihydro-3'H-spiro[piperidine-4,1'-pyrano[3,4-b]indole]

    CAS No.: 724458-48-4
    Catalog No.: TQR0192
    Purity: 95%
    MF: C15H18N2O
    MW: 242.322
    Storage: 2-8 degree Celsius
    SMILES: C12(OCCC3=C1NC1=CC=CC=C31)CCNCC2
  5. 1-(6-chloro-5-fluoro-1H-indol-3-yl)propan-2-one

    CAS No.: 1458665-08-1
    Catalog No.: TQR0222
    Purity: 95%
    MF: C11H9ClFNO
    MW: 225.65
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C2C(=CNC2=C1)CC(C)=O)F
  6. 6-chloro-5-fluoro-1H-indole-3-carbaldehyde

    CAS No.: 467451-99-6
    Catalog No.: TQR0223
    Purity: 95%
    MF: C9H5ClFNO
    MW: 197.596
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C2C(=CNC2=C1)C=O)F
  7. (S)-1-(6-chloro-5-fluoro-1H-indol-3-yl)propan-2-amine

    CAS No.: 1193314-86-1
    Catalog No.: TQR0224
    Purity: 95%
    MF: C11H12ClFN2
    MW: 226.682
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C2C(=CNC2=C1)C[C@H](C)N)F
  8. 1-(6-chloro-5-fluoro-1H-indol-3-yl)propan-2-amine

    CAS No.: 1193314-75-8
    Catalog No.: TQR0225
    Purity: 95%
    MF: C11H12ClFN2
    MW: 226.682
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C2C(=CNC2=C1)CC(C)N)F
  9. (S)-3-((tert-butoxycarbonyl)amino)-3-(1H-indol-3-yl)propanoic acid

    CAS No.: 1260614-44-5
    Catalog No.: TQR0341
    Purity: 95%
    MF: C16H20N2O4
    MW: 304.346
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CNC2=CC=CC=C12
  10. 5-chloro-1-methyl-1H-indole-2-carbaldehyde

    CAS No.: 883529-71-3
    Catalog No.: TQR0471
    Purity: 95%
    MF: C10H8ClNO
    MW: 193.633
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2C=C(N(C2=CC1)C)C=O
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 768 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6