•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indoles

Set Descending Direction

   

Items 1 to 10 of 2143 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (1H-indol-4-yl)boronic acid

    CAS No.: 220465-43-0
    Catalog No.: 100172
    Purity: 95%
    MF: C8H8BNO2
    MW: 160.969
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=CC=CC2=C1C=CN2
  2. 4-bromo-6-fluoro-1H-indole

    CAS No.: 885520-70-7
    Catalog No.: 100176
    Purity: 95%
    MF: C8H5BrFN
    MW: 214.037
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(C=CN2)C(Br)=C1
  3. (6-fluoro-1H-indol-4-yl)methanamine

    CAS No.: 1422057-38-2
    Catalog No.: 100550
    Purity: 95%
    MF: C9H9FN2
    MW: 164.183
    Storage: 2-8 degree Celsius
    SMILES: NCC1=CC(F)=CC2=C1C=CN2
  4. 1H-indol-3-yl acetate

    CAS No.: 608-08-2
    Catalog No.: 100590
    Purity: 95%
    MF: C10H9NO2
    MW: 175.187
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)OC1=CNC2=C1C=CC=C2
  5. 6-fluoro-1H-indole-4-carbonitrile

    CAS No.: 1082040-44-5
    Catalog No.: 100765
    Purity: 95%
    MF: C9H5FN2
    MW: 160.151
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(C=CN2)C(=C1)C#N
  6. 7-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole

    CAS No.: 936901-92-7
    Catalog No.: 100791
    Purity: 95%
    MF: C14H17BClNO2
    MW: 277.56
    Storage: 2-8 degree Celsius
  7. 4-fluoro-2-methyl-1H-indol-5-ol

    CAS No.: 288385-88-6
    Catalog No.: 100960
    Purity: 95%
    MF: C9H8FNO
    MW: 165.167
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(N1)C=CC(O)=C2F
  8. (E)-3-(2,4-dimethyl-5-((2-oxoindolin-3-ylidene)methyl)-1H-pyrrol-3-yl)propanoic acid

    CAS No.: 252916-29-3
    Catalog No.: 101022
    Purity: 95%
    MF: C18H18N2O3
    MW: 310.353
    Storage: 2-8 degree Celsius
  9. 5,6-difluoro-1H-indole-2-carboxylic acid

    CAS No.: 169674-35-5
    Catalog No.: 101348
    Purity: 95%
    MF: C9H5F2NO2
    MW: 197.14
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC2=C(N1)C=C(F)C(F)=C2
  10. 9H-pyrido[3,4-b]indole-3-carbonitrile

    CAS No.: 83911-48-2
    Catalog No.: 101362
    Purity: 95%
    MF: C12H7N3
    MW: 193.209
    Storage: 2-8 degree Celsius
    SMILES: N#CC1=CC2=C(NC3=C2C=CC=C3)C=N1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 2143 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5