•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indenes

Set Ascending Direction

   

Items 51 to 60 of 158 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. 6-bromo-5-fluoro-1-indanone

    CAS No.: 1273595-81-5
    Catalog No.: WLZ3277
    Purity: 95%
    MF: C9H6BrFO
    MW: 229.048
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C2CCC(C2=C1)=O)F
  2. 5-bromo-4-chloro-1-indanone

    CAS No.: 1273608-49-3
    Catalog No.: WLZ3279
    Purity: 95%
    MF: C9H6BrClO
    MW: 245.503
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=C2CCC(C2=CC1)=O)Cl
  3. 6-bromo-4-fluoro-1-indanone

    CAS No.: 881189-74-8
    Catalog No.: WLZ3283
    Purity: 95%
    MF: C9H6BrFO
    MW: 229.048
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=C2CCC(C2=C1)=O)F
  4. 1-(2,3-dihydro-1H-inden-5-yl)ethanone

    CAS No.: 4228-10-8
    Catalog No.: WLZ3294
    Purity: 95%
    MF: C11H12O
    MW: 160.216
    Storage: 2-8 degree Celsius
    SMILES: C1CCC2=CC(=CC=C12)C(C)=O
  5. (1R,2S)-1-amino-2,3-dihydro-1H-inden-2-ol

    CAS No.: 136030-00-7
    Catalog No.: 126616
    Purity: 95%
    MF: C9H11NO
    MW: 149.193
    Storage: 2-8 degree Celsius
    SMILES: N[C@H]1[C@@H](O)CC2=C1C=CC=C2
  6. (1S,2R)-1-amino-2,3-dihydro-1H-inden-2-ol

    CAS No.: 126456-43-7
    Catalog No.: 126617
    Purity: 95%
    MF: C9H11NO
    MW: 149.193
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]1[C@H](O)CC2=C1C=CC=C2
  7. 4-bromo-5-chloro-1-indanone

    CAS No.: 66790-63-4
    Catalog No.: 134181
    Purity: 95%
    MF: C9H6BrClO
    MW: 245.503
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C(=O)CCC2=C1Br
  8. (S)-5-bromo-2,3-dihydro-1H-inden-1-amine hydrochloride

    CAS No.: 916210-93-0
    Catalog No.: 136737
    Purity: 95%
    MF: C9H11BrClN
    MW: 248.551
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@H]1CCC2=CC(Br)=CC=C12
  9. 2-(3-oxo-2,3-dihydro-1H-inden-1-ylidene)malononitrile

    CAS No.: 1080-74-6
    Catalog No.: 184380
    Purity: 95%
    MF: C12H6N2O
    MW: 194.193
    Storage: 2-8 degree Celsius
    SMILES: O=C1CC(=C(C#N)C#N)C2=CC=CC=C12
  10. (R)-N-(Prop-2-ynyl)-2,3-dihydro-1H-inden-1-amine

    CAS No.: 136236-51-6
    Catalog No.: 196606
    Purity: 95%
    MF: C12H13N
    MW: 171.243
    Storage: 2-8 degree Celsius
    SMILES: C(C#C)N[C@@H]1CCC2=CC=CC=C12
Loading ...Load More ...
Set Ascending Direction

   

Items 51 to 60 of 158 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8