•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indenes

Set Descending Direction

   

Items 1 to 10 of 543 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-bromo-4-nitro-2,3-dihydro-1H-inden-5-ol

    CAS No.: 139515-86-9
    Catalog No.: 100881
    Purity: 95%
    MF: C9H8BrNO3
    MW: 258.071
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C2=C(CCC2)C=C1Br)[N+]([O-])=O
  2. (R)-2,3-dihydro-1H-inden-1-amine

    CAS No.: 10277-74-4
    Catalog No.: 101340
    Purity: 95%
    MF: C9H11N
    MW: 133.194
    Storage: 2-8 degree Celsius
  3. 6-methoxy-2,3-dihydro-1H-inden-1-amine

    CAS No.: 103028-81-5
    Catalog No.: 102235
    Purity: 95%
    MF: C10H13NO
    MW: 163.22
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(CCC2N)C=C1
  4. 6-methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride

    CAS No.: 103028-80-4
    Catalog No.: 102941
    Purity: 95%
    MF: C10H14ClNO
    MW: 199.681
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].COC1=CC2=C(CCC2N)C=C1
  5. tert-butyl 5-amino-2,3-dihydro-1H-inden-2-ylcarbamate

    CAS No.: 246873-45-0
    Catalog No.: 103136
    Purity: 95%
    MF: C14H20N2O2
    MW: 248.326
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC1CC2=C(C1)C=C(N)C=C2
  6. 5-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid

    CAS No.: 116854-10-5
    Catalog No.: 103162
    Purity: 95%
    MF: C11H12O3
    MW: 192.214
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=C1)C(CC2)C(O)=O
  7. (2-amino-2,3-dihydro-1H-inden-2-yl)methanol

    CAS No.: 136834-85-0
    Catalog No.: 104999
    Purity: 95%
    MF: C10H13NO
    MW: 163.22
    Storage: 2-8 degree Celsius
  8. 6-bromo-2,3-dihydro-1H-inden-1-one

    CAS No.: 14548-39-1
    Catalog No.: 105347
    Purity: 95%
    MF: C9H7BrO
    MW: 211.058
    Storage: 2-8 degree Celsius
  9. 7-bromo-2,3-dihydro-1H-inden-1-one

    CAS No.: 125114-77-4
    Catalog No.: 105629
    Purity: 95%
    MF: C9H7BrO
    MW: 211.058
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=CC2=C1C(=O)CC2
  10. 7-chloro-2,3-dihydro-1H-inden-1-one

    CAS No.: 34911-25-6
    Catalog No.: 105703
    Purity: 95%
    MF: C9H7ClO
    MW: 166.607
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 543 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5