•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indenes

Set Ascending Direction

   

Items 11 to 20 of 158 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (R)-methyl 2-(ethylamino)-2,3-dihydro-1H-indene-5-carboxylate

    CAS No.: 2374750-10-2
    Catalog No.: TQR0030
    Purity: 95%
    MF: C13H17NO2
    MW: 219.284
    Storage: 2-8 degree Celsius
    SMILES: C(C)N[C@@H]1CC2=CC=C(C=C2C1)C(=O)OC
  2. (R)-methyl 2-amino-2,3-dihydro-1H-indene-5-carboxylate hydrochloride

    CAS No.: 2374750-07-7
    Catalog No.: TQR0031
    Purity: 95%
    MF: C11H14ClNO2
    MW: 227.691
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@@H]1CC2=CC=C(C=C2C1)C(=O)OC
  3. (R)-methyl 2-amino-2,3-dihydro-1H-indene-5-carboxylate

    CAS No.: 2374750-06-6
    Catalog No.: TQR0032
    Purity: 95%
    MF: C11H13NO2
    MW: 191.23
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]1CC2=CC=C(C=C2C1)C(=O)OC
  4. 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid hydrochloride

    CAS No.: 149506-48-9
    Catalog No.: TQR0033
    Purity: 95%
    MF: C10H12ClNO2
    MW: 213.664
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1CC2=CC=C(C=C2C1)C(=O)O
  5. 2-((tert-butoxycarbonyl)amino)-2,3-dihydro-1H-indene-5-carboxylic acid

    CAS No.: 149506-00-3
    Catalog No.: TQR0034
    Purity: 95%
    MF: C15H19NO4
    MW: 277.32
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC1CC2=CC=C(C=C2C1)C(=O)O
  6. tert-butyl (1-oxo-2,3-dihydro-1H-inden-5-yl)carbamate

    CAS No.: 1116358-96-3
    Catalog No.: TQR0182
    Purity: 95%
    MF: C14H17NO3
    MW: 247.294
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCC2=CC(=CC=C12)NC(OC(C)(C)C)=O
  7. 7-((difluoromethyl)sulfonyl)-4-fluoro-2,3-dihydro-1H-inden-1-one

    CAS No.: 1672661-81-2
    Catalog No.: TQR0357
    Purity: 95%
    MF: C10H7F3O3S
    MW: 264.224
    Storage: 2-8 degree Celsius
    SMILES: FC(S(=O)(=O)C=1C=CC(=C2CCC(C12)=O)F)F
  8. tert-butyl ((1S,2S)-2-amino-2,3-dihydro-1H-inden-1-yl)carbamate

    CAS No.: 597555-55-0
    Catalog No.: TQR0477
    Purity: 95%
    MF: C14H20N2O2
    MW: 248.326
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]1[C@H](C2=CC=CC=C2C1)NC(OC(C)(C)C)=O
  9. tert-butyl ((1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl)carbamate

    CAS No.: 403860-48-0
    Catalog No.: TQR0478
    Purity: 95%
    MF: C14H20N2O2
    MW: 248.326
    Storage: 2-8 degree Celsius
    SMILES: N[C@H]1[C@@H](C2=CC=CC=C2C1)NC(OC(C)(C)C)=O
  10. tert-butyl ((1R,2S)-2-amino-2,3-dihydro-1H-inden-1-yl)carbamate

    CAS No.: 766556-69-8
    Catalog No.: TQR0479
    Purity: 95%
    MF: C14H20N2O2
    MW: 248.326
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]1[C@@H](C2=CC=CC=C2C1)NC(OC(C)(C)C)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 158 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5