•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indazoles

Set Descending Direction

   

Items 21 to 30 of 1139 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-methyl-1H-indazol-6-ylamine

    CAS No.: 79173-62-9
    Catalog No.: 102403
    Purity: 95%
    MF: C8H9N3
    MW: 147.181
    Storage: 2-8 degree Celsius
    SMILES: CC1=NNC2=C1C=CC(N)=C2
  2. 3-methyl-6-nitroindazole

    CAS No.: 6494-19-5
    Catalog No.: 102404
    Purity: 95%
    MF: C8H7N3O2
    MW: 177.163
    Storage: 2-8 degree Celsius
    SMILES: CC1=NNC2=C1C=CC(=C2)[N+]([O-])=O
  3. 5-iodo-1H-indazole

    CAS No.: 55919-82-9
    Catalog No.: 102537
    Purity: 95%
    MF: C7H5IN2
    MW: 244.035
    Storage: 2-8 degree Celsius
  4. 7-bromo-5-methoxy-1H-indazole

    CAS No.: 1100214-10-5
    Catalog No.: 102583
    Purity: 95%
    MF: C8H7BrN2O
    MW: 227.061
    Storage: 2-8 degree Celsius
  5. 1H-indazole-7-carboxylic acid

    CAS No.: 677304-69-7
    Catalog No.: 102585
    Purity: 95%
    MF: C8H6N2O2
    MW: 162.148
    Storage: 2-8 degree Celsius
  6. 7-bromo-2-methyl-2H-indazole

    CAS No.: 701910-14-7
    Catalog No.: 102677
    Purity: 95%
    MF: C8H7BrN2
    MW: 211.062
    Storage: 2-8 degree Celsius
  7. tert-butyl 6-amino-1H-indazole-1-carboxylate

    CAS No.: 219503-81-8
    Catalog No.: 102754
    Purity: 95%
    MF: C12H15N3O2
    MW: 233.271
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1N=CC2=C1C=C(N)C=C2
  8. 3-bromo-6-nitro-1H-indazole

    CAS No.: 70315-68-3
    Catalog No.: 102828
    Purity: 95%
    MF: C7H4BrN3O2
    MW: 242.032
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC2=C(C=C1)C(Br)=NN2
  9. 1,4,6,7-tetrahydro-5H-indazol-5-one

    CAS No.: 1196154-00-3
    Catalog No.: 102855
    Purity: 95%
    MF: C7H8N2O
    MW: 136.154
    Storage: 2-8 degree Celsius
  10. 3-bromo-5-nitro-1H-indazole

    CAS No.: 67400-25-3
    Catalog No.: 102922
    Purity: 95%
    MF: C7H4BrN3O2
    MW: 242.032
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 1139 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5