•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indazoles

Set Ascending Direction

   

Items 11 to 20 of 1139 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1-(4-methoxybenzyl)-5-nitro-1H-indazole

    CAS No.: 1071550-12-3
    Catalog No.: 100579
    Purity: 95%
    MF: C15H13N3O3
    MW: 283.287
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(CN2N=CC3=C2C=CC(=C3)[N+]([O-])=O)C=C1
  2. 2-(4-methoxybenzyl)-5-nitro-2H-indazole

    CAS No.: 1178903-41-7
    Catalog No.: 100580
    Purity: 95%
    MF: C15H13N3O3
    MW: 283.287
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(CN2C=C3C=C(C=CC3=N2)[N+]([O-])=O)C=C1
  3. 3-bromo-4-chloro-1H-indazole

    CAS No.: 885521-40-4
    Catalog No.: 100691
    Purity: 95%
    MF: C7H4BrClN2
    MW: 231.48
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=CC2=C1C(Br)=NN2
  4. 4-chloro-1H-indazole

    CAS No.: 13096-96-3
    Catalog No.: 100692
    Purity: 95%
    MF: C7H5ClN2
    MW: 152.584
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=CC2=C1C=NN2
  5. 4-iodo-1H-indazol-3-amine

    CAS No.: 599191-73-8
    Catalog No.: 101014
    Purity: 95%
    MF: C7H6IN3
    MW: 259.05
    Storage: 2-8 degree Celsius
    SMILES: NC1=NNC2=C1C(I)=CC=C2
  6. 4-(4-aminophenyl)-1H-indazol-3-amine

    CAS No.: 819058-89-4
    Catalog No.: 101059
    Purity: 95%
    MF: C13H12N4
    MW: 224.267
    Storage: 2-8 degree Celsius
    SMILES: NC1=NNC2=C1C(=CC=C2)C1=CC=C(N)C=C1
  7. 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole

    CAS No.: 862723-42-0
    Catalog No.: 101235
    Purity: 95%
    MF: C13H17BN2O2
    MW: 244.103
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)C1=CC2=C(NN=C2)C=C1
  8. 5-fluoro-3-indazolecarboxylic acid

    CAS No.: 1077-96-9
    Catalog No.: 101347
    Purity: 95%
    MF: C8H5FN2O2
    MW: 180.138
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=NNC2=C1C=C(F)C=C2
  9. 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-amine

    CAS No.: 953411-16-0
    Catalog No.: 101558
    Purity: 95%
    MF: C13H18BN3O2
    MW: 259.118
    Storage: 2-8 degree Celsius
  10. 3-methyl-1H-indazol-5-amine

    CAS No.: 90764-90-2
    Catalog No.: 102402
    Purity: 95%
    MF: C8H9N3
    MW: 147.181
    Storage: 2-8 degree Celsius
    SMILES: CC1=NNC2=C1C=C(N)C=C2
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 1139 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5