•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indazoles

Set Ascending Direction

   

Items 41 to 50 of 405 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 5-bromo-4-fluoro-1H-indazole

    CAS No.: 1082041-85-7
    Catalog No.: 108665
    Purity: 95%
    MF: C7H4BrFN2
    MW: 215.025
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(Br)C=CC2=C1C=NN2
  2. 3-bromo-6-methoxy-1H-indazole

    CAS No.: 1134328-18-9
    Catalog No.: 110133
    Purity: 95%
    MF: C8H7BrN2O
    MW: 227.061
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=C1)C(Br)=NN2
  3. 6-methoxy-1H-indazole

    CAS No.: 3522-07-4
    Catalog No.: 110134
    Purity: 95%
    MF: C8H8N2O
    MW: 148.165
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=NN2)C=C1
  4. 6-methoxy-1H-indazole-3-carboxylic acid

    CAS No.: 518990-36-8
    Catalog No.: 110178
    Purity: 95%
    MF: C9H8N2O3
    MW: 192.174
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C=C1)C(=NN2)C(O)=O
  5. (1H-indazol-4-yl)methanol

    CAS No.: 709608-85-5
    Catalog No.: 110220
    Purity: 95%
    MF: C8H8N2O
    MW: 148.165
    Storage: 2-8 degree Celsius
    SMILES: OCC1=CC=CC2=C1C=NN2
  6. 7-(benzyloxy)-1H-indazole

    CAS No.: 351210-09-8
    Catalog No.: 110319
    Purity: 95%
    MF: C14H12N2O
    MW: 224.263
    Storage: 2-8 degree Celsius
    SMILES: C(OC1=CC=CC2=C1NN=C2)C1=CC=CC=C1
  7. 1H-indazol-7-ol

    CAS No.: 81382-46-9
    Catalog No.: 110320
    Purity: 95%
    MF: C7H6N2O
    MW: 134.138
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=CC2=C1NN=C2
  8. 4-methoxy-1H-indazole

    CAS No.: 351210-06-5
    Catalog No.: 110341
    Purity: 95%
    MF: C8H8N2O
    MW: 148.165
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=CC2=C1C=NN2
  9. 6-(benzyloxy)-1H-indazole

    CAS No.: 874668-62-9
    Catalog No.: 110356
    Purity: 95%
    MF: C14H12N2O
    MW: 224.263
    Storage: 2-8 degree Celsius
    SMILES: C(OC1=CC2=C(C=NN2)C=C1)C1=CC=CC=C1
  10. 6-methyl-1H-indazole

    CAS No.: 698-24-8
    Catalog No.: 110363
    Purity: 95%
    MF: C8H8N2
    MW: 132.166
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(C=NN2)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 405 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7