•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Imidazopyridazines

Set Descending Direction

   

Items 1 to 10 of 79 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-chloroimidazo[1,2-b]pyridazine hydrochloride

    CAS No.: 13493-79-3
    Catalog No.: 171112
    Purity: 95%
    MF: C6H5Cl2N3
    MW: 190.033
    Storage: 2-8 degree Celsius
    SMILES: Cl.ClC1=NN2C=CN=C2C=C1
  2. 6-bromo-2-methylimidazo[1,2-b]pyridazine

    CAS No.: 1936575-36-8
    Catalog No.: ZB1825
    Purity: 95%
    MF: C7H6BrN3
    MW: 212.05
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC=2N(N1)C=C(N2)C
  3. 2,8-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-b]pyridazine

    CAS No.: 1825352-86-0
    Catalog No.: TQR0467
    Purity: 95%
    MF: C14H20BN3O2
    MW: 273.145
    Storage: 2-8 degree Celsius
    SMILES: CC=1N=C2N(N=C(C=C2C)B2OC(C(O2)(C)C)(C)C)C1
  4. 6-chloro-8-methylimidazo[1,2-b]pyridazine-2-carboxylic acid

    CAS No.: 64068-13-9
    Catalog No.: TQP3001
    Purity: 95%
    MF: C8H6ClN3O2
    MW: 211.608
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=2N(N1)C=C(N2)C(=O)O)C
  5. 2-(6-chloro-8-methylimidazo[1,2-b]pyridazin-2-yl)acetic acid

    CAS No.: 64068-12-8
    Catalog No.: TQP3000
    Purity: 95%
    MF: C9H8ClN3O2
    MW: 225.635
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=2N(N1)C=C(N2)CC(=O)O)C
  6. ethyl 2-(6-chloro-8-methylimidazo[1,2-b]pyridazin-2-yl)acetate

    CAS No.: 64068-01-5
    Catalog No.: TQP2999
    Purity: 95%
    MF: C11H12ClN3O2
    MW: 253.689
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=2N(N1)C=C(N2)CC(=O)OCC)C
  7. ethyl 6-chloro-8-methylimidazo[1,2-b]pyridazine-2-carboxylate

    CAS No.: 64068-04-8
    Catalog No.: TQP2998
    Purity: 95%
    MF: C10H10ClN3O2
    MW: 239.662
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=2N(N1)C=C(N2)C(=O)OCC)C
  8. ethyl 6-bromoimidazo[1,2-b]pyridazine-2-carboxylate

    CAS No.: 1187236-98-1
    Catalog No.: 171523
    Purity: 95%
    MF: C9H8BrN3O2
    MW: 270.086
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C1=CN2N=C(Br)C=CC2=N1
  9. methyl 3-bromoimidazo[1,2-b]pyridazine-6-carboxylate

    CAS No.: 1234616-07-9
    Catalog No.: 171372
    Purity: 95%
    MF: C8H6BrN3O2
    MW: 256.059
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=NN2C(Br)=CN=C2C=C1
  10. methyl imidazo[1,2-b]pyridazine-6-carboxylate

    CAS No.: 1234616-21-7
    Catalog No.: 171366
    Purity: 95%
    MF: C8H7N3O2
    MW: 177.163
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=NN2C=CN=C2C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 79 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5