•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Imidazopyrazines

Set Descending Direction

   

Items 1 to 10 of 184 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-bromo-N-propylimidazo[1,2-b]pyridazin-6-amine

    CAS No.: 1034621-79-8
    Catalog No.: 101161
    Purity: 95%
    MF: C9H11BrN4
    MW: 255.119
    Storage: 2-8 degree Celsius
    SMILES: CCCNC1=NN2C(Br)=CN=C2C=C1
  2. 1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyrazine hydrochloride

    CAS No.: 1359655-82-5
    Catalog No.: 102228
    Purity: 95%
    MF: C6H12ClN3
    MW: 161.636
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].C1CN2C=CNC2CN1
  3. 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine

    CAS No.: 91476-80-1
    Catalog No.: 102508
    Purity: 95%
    MF: C6H9N3
    MW: 123.159
    Storage: 2-8 degree Celsius
  4. 8-chloro-3-isopropylimidazo[1,5-a]pyrazine

    CAS No.: 1320266-90-7
    Catalog No.: 104227
    Purity: 95%
    MF: C9H10ClN3
    MW: 195.653
    Storage: 2-8 degree Celsius
  5. 8-chloro-1-iodo-3-isopropylimidazo[1,5-a]pyrazine

    CAS No.: 1320266-92-9
    Catalog No.: 104228
    Purity: 95%
    MF: C9H9ClIN3
    MW: 321.549
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=NC(I)=C2N1C=CN=C2Cl
  6. 1-iodo-3-isopropylimidazo[1,5-a]pyrazin-8-amine

    CAS No.: 1320266-94-1
    Catalog No.: 104229
    Purity: 95%
    MF: C9H11IN4
    MW: 302.119
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=NC(I)=C2N1C=CN=C2N
  7. 8-chloro-3-iodoimidazo[1,2-a]pyrazine

    CAS No.: 1049677-32-8
    Catalog No.: 104230
    Purity: 95%
    MF: C6H3ClIN3
    MW: 279.468
    Storage: 2-8 degree Celsius
  8. 6-bromo-1-(pentan-3-yl)-1H-imidazo[4,5-b]pyrazin-2-ol

    CAS No.: 1005490-98-1
    Catalog No.: 105459
    Purity: 95%
    MF: C10H13BrN4O
    MW: 285.145
    Storage: 2-8 degree Celsius
  9. 2-(1H-imidazol-2-yl)pyrazine

    CAS No.: 119165-68-3
    Catalog No.: 105946
    Purity: 95%
    MF: C7H6N4
    MW: 146.153
    Storage: 2-8 degree Celsius
  10. 6,8-dibromoimidazo[1,2-a]pyrazine

    CAS No.: 63744-22-9
    Catalog No.: 106344
    Purity: 95%
    MF: C6H3Br2N3
    MW: 276.919
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 184 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5