•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Imidazolidines

Set Descending Direction

   

Items 11 to 20 of 23 total

  1. 1
  2. 2
  3. 3
  1. N-(imidazolidin-2-ylidene)nitramide

    CAS No.: 54565-96-3
    Catalog No.: 194675
    Purity: 95%
    MF: C3H6N4O2
    MW: 130.107
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])N=C1NCCN1
  2. N-(1,3-bis((6-chloropyridin-3-yl)methyl)imidazolidin-2-ylidene)nitramide

    CAS No.: 105828-41-9
    Catalog No.: 194674
    Purity: 95%
    MF: C15H14Cl2N6O2
    MW: 381.223
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=N1)CN1C(N(CC1)CC=1C=NC(=CC1)Cl)=N[N+](=O)[O-]
  3. 4-(2-imino-3-methyl-5-oxoimidazolidin-1-yl)butanoic acid

    CAS No.: 213181-98-7
    Catalog No.: 183951
    Purity: 95%
    MF: C8H13N3O3
    MW: 199.21
    Storage: 2-8 degree Celsius
    SMILES: CN1CC(=O)N(CCCC(O)=O)C1=N
  4. 1-(3-aminophenyl)-3-methylimidazolidin-2-one

    CAS No.: 517918-82-0
    Catalog No.: ZB2139
    Purity: 95%
    MF: C10H13N3O
    MW: 191.234
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C(C=CC1)N1C(N(CC1)C)=O
  5. 1-(methylsulfonyl)imidazolidin-2-one

    CAS No.: 41730-79-4
    Catalog No.: LT0235
    Purity: 95%
    MF: C4H8N2O3S
    MW: 164.186
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)N1C(NCC1)=O
  6. Satranidazole

    CAS No.: 56302-13-7
    Catalog No.: LT0141
    Purity: 95%
    MF: C8H11N5O5S
    MW: 289.273
    Storage: 2-8 degree Celsius
    SMILES: CN1C(=NC=C1[N+](=O)[O-])N1C(N(CC1)S(=O)(=O)C)=O
  7. (R)-1-methyl-3-(piperidin-3-yl)imidazolidin-2-one

    CAS No.: 1791402-89-5
    Catalog No.: 194306
    Purity: 95%
    MF: C9H17N3O
    MW: 183.255
    Storage: 2-8 degree Celsius
    SMILES: CN1C(N(CC1)[C@H]1CNCCC1)=O
  8. (S)-3-(benzyloxycarbonyl)-2-oxoimidazolidine-4-carboxylic acid

    CAS No.: 59760-01-9
    Catalog No.: 192686
    Purity: 95%
    MF: C12H12N2O5
    MW: 264.237
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC(=O)N1C(NC[C@H]1C(=O)O)=O
  9. (S)-2-oxoimidazolidine-4-carboxylic acid

    CAS No.: 41371-53-3
    Catalog No.: 192685
    Purity: 95%
    MF: C4H6N2O3
    MW: 130.103
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC[C@H](N1)C(=O)O
  10. (R)-2-oxoimidazolidine-4-carboxylic acid

    CAS No.: 214767-15-4
    Catalog No.: 192684
    Purity: 95%
    MF: C4H6N2O3
    MW: 130.103
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC[C@@H](N1)C(=O)O
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 23 total

  1. 1
  2. 2
  3. 3