•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

HSP (e.g. HSP90)

Set Descending Direction

   

Items 11 to 20 of 25 total

  1. 1
  2. 2
  3. 3
  1. NSC 707545

    CAS No.: 467214-20-6
    Catalog No.: 159942
    Purity: 95%
    MF: C32H48N4O8
    MW: 616.756
    Storage: 2-8 degree Celsius
    SMILES: CO[C@H]1C[C@H](C)CC2=C(NCCN(C)C)C(=O)C=C(NC(=O)\C(C)=C\C=C/[C@H](OC)[C@@H](OC(N)=O)\C(C)=C\[C@H](C)[C@H]1O)C2=O
  2. DTHIB

    CAS No.: 897326-30-6
    Catalog No.: 193658
    Purity: 95%
    MF: C13H9ClFN3O3
    MW: 309.684
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C(C=C1)NC(=O)NC1=CC=C(C=C1)F)[N+](=O)[O-]
  3. VER-49009

    CAS No.: 558640-51-0
    Catalog No.: 151997
    Purity: 95%
    MF: C19H18ClN3O4
    MW: 387.823
    Storage: 2-8 degree Celsius
    SMILES: CCNC(=O)C1=NNC(=C1C1=CC=C(OC)C=C1)C1=C(O)C=C(O)C(Cl)=C1
  4. Ganetespib; STA-9090

    CAS No.: 888216-25-9
    Catalog No.: 101186
    Purity: 95%
    MF: C20H20N4O3
    MW: 364.405
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=C(O)C=C(O)C(=C1)C1=NNC(=O)N1C1=CC2=C(C=C1)N(C)C=C2
  5. PF-04929113; SNX-5422

    CAS No.: 908115-27-5
    Catalog No.: 151755
    Purity: 95%
    MF: C25H30F3N5O4
    MW: 521.54
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)CC2=C(C(=NN2C2=CC(N[C@H]3CC[C@@H](CC3)OC(=O)CN)=C(C=C2)C(N)=O)C(F)(F)F)C(=O)C1
  6. KNK437

    CAS No.: 218924-25-5
    Catalog No.: 152075
    Purity: 95%
    MF: C13H11NO4
    MW: 245.234
    Storage: 2-8 degree Celsius
    SMILES: O=CN1CCC(=CC2=CC3=C(OCO3)C=C2)C1=O
  7. XL888

    CAS No.: 1149705-71-4
    Catalog No.: 141856
    Purity: 95%
    MF: C29H37N5O3
    MW: 503.647
    Storage: 2-8 degree Celsius
    SMILES: CC[C@@H](C)NC1=C(C=C(C)C(=C1)C(=O)N[C@H]1CC2CC[C@@H](C1)N2C1=NC=C(C=C1)C(=O)C1CC1)C(N)=O
  8. Onalespib; AT13387

    CAS No.: 912999-49-6
    Catalog No.: 141356
    Purity: 95%
    MF: C24H31N3O3
    MW: 409.53
    Storage: 2-8 degree Celsius
    SMILES: CC(C)C1=C(O)C=C(O)C(=C1)C(=O)N1CC2=C(C1)C=C(CN1CCN(C)CC1)C=C2
  9. HSP990; NVP-HSP990

    CAS No.: 934343-74-5
    Catalog No.: 134420
    Purity: 95%
    MF: C20H18FN5O2
    MW: 379.395
    Storage: 2-8 degree Celsius
  10. NVP-BEP800

    CAS No.: 847559-80-2
    Catalog No.: 113161
    Purity: 95%
    MF: C21H23Cl2N5O2S
    MW: 480.421
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 25 total

  1. 1
  2. 2
  3. 3