•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

HSP (e.g. HSP90)

Set Descending Direction

   

Items 1 to 10 of 25 total

  1. 1
  2. 2
  3. 3
  1. VER155008

    CAS No.: 1134156-31-2
    Catalog No.: 152076
    Purity: 95%
    MF: C25H23Cl2N7O4
    MW: 556.41
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2N=C(NCC3=CC(Cl)=C(Cl)C=C3)N([C@@H]3O[C@H](COCC4=CC=C(C=C4)C#N)[C@@H](O)[C@H]3O)C2=NC=N1
  2. YUM70

    CAS No.: 423145-35-1
    Catalog No.: WLZ0219
    Purity: 95%
    MF: C21H19ClN2O4
    MW: 398.846
    Storage: 2-8 degree Celsius
    SMILES: O1COC2=C1C=CC(=C2)C(NC(CCC)=O)C2=CC(=C1C=CC=NC1=C2O)Cl
  3. Arimoclomol

    CAS No.: 289893-25-0
    Catalog No.: 194726
    Purity: 95%
    MF: C14H20ClN3O3
    MW: 313.785
    Storage: 2-8 degree Celsius
    SMILES: ClC(C=1C=CC=[N+](C1)[O-])=NOC[C@@H](CN1CCCCC1)O
  4. PU-H54

    CAS No.: 1454619-13-6
    Catalog No.: 194576
    Purity: 95%
    MF: C18H19N5S
    MW: 337.452
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C=CC(=C1)C)SC=1N=C2N(C=NC(=C2N1)N)CCCC#C
  5. CCT251236

    CAS No.: 1693731-40-6
    Catalog No.: 186333
    Purity: 95%
    MF: C32H32N4O5
    MW: 552.631
    Storage: 2-8 degree Celsius
    SMILES: O1C2=C(OCC1)C=C(C=C2)C(=O)NC=2C=CC(=C(C2)NC(=O)C=2C=C1C=CC(=NC1=CC2)OCCN2CCCC2)C
  6. VER50589

    CAS No.: 747413-08-7
    Catalog No.: 186265
    Purity: 95%
    MF: C19H17ClN2O5
    MW: 388.807
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=CC(=C(C1)C1=C(C(=NO1)C(=O)NCC)C1=CC=C(C=C1)OC)O)O
  7. Debio 0932(CUDC-305 )

    CAS No.: 1061318-81-7
    Catalog No.: 186233
    Purity: 95%
    MF: C22H30N6O2S
    MW: 442.589
    Storage: 2-8 degree Celsius
    SMILES: CN(C=1C(=CC2=C(OCO2)C1)SC=1N(C2=C(C(=NC=C2)N)N1)CCNCC(C)(C)C)C
  8. KRIBB11

    CAS No.: 342639-96-7
    Catalog No.: 186218
    Purity: 95%
    MF: C13H12N6O2
    MW: 284.279
    Storage: 2-8 degree Celsius
    SMILES: N1N=CC2=CC(=CC=C12)NC1=NC(=CC=C1[N+](=O)[O-])NC
  9. PU-H71

    CAS No.: 873436-91-0
    Catalog No.: 186131
    Purity: 95%
    MF: C18H21IN6O2S
    MW: 512.377
    Storage: 2-8 degree Celsius
    SMILES: IC=1C(=CC2=C(OCO2)C1)SC=1N(C2=NC=NC(=C2N1)N)CCCNC(C)C
  10. Apoptozole

    CAS No.: 1054543-47-3
    Catalog No.: 169644
    Purity: 95%
    MF: C33H25F6N3O3
    MW: 625.569
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=C1)C1=C(N(CC2=CC=C(C=C2)C(N)=O)C(=N1)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C1=CC=C(OC)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 25 total

  1. 1
  2. 2
  3. 3