•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

GPCR & G Protein

Set Ascending Direction

   

Items 11 to 20 of 422 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Ciproxifan maleate

    CAS No.: 184025-19-2
    Catalog No.: 104798
    Purity: 95%
    MF: C20H22N2O6
    MW: 386.404
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C/C(O)=O.O=C(C1CC1)C1=CC=C(OCCCC2=CN=CN2)C=C1
  2. Dapagliflozin

    CAS No.: 461432-26-8
    Catalog No.: 104815
    Purity: 95%
    MF: C21H25ClO6
    MW: 408.878
    Storage: 2-8 degree Celsius
  3. Indacaterol

    CAS No.: 312753-06-3
    Catalog No.: 104909
    Purity: 95%
    MF: C24H28N2O3
    MW: 392.499
    Storage: 2-8 degree Celsius
    SMILES: CCC1=CC2=C(CC(C2)NC[C@H](O)C2=CC=C(O)C3=C2C=CC(=O)N3)C=C1CC
  4. RS 504393

    CAS No.: 300816-15-3
    Catalog No.: 104843
    Purity: 95%
    MF: C25H27N3O3
    MW: 417.509
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(CCN2CCC3(CC2)OC(=O)NC2=CC=C(C)C=C32)N=C(O1)C1=CC=CC=C1
  5. WIN 55,212-2 Mesylate

    CAS No.: 131543-23-2
    Catalog No.: 104833
    Purity: 95%
    MF: C28H30N2O6S
    MW: 522.623
    Storage: -20 degree Celsius
    SMILES: CS(O)(=O)=O.CC1=C(C(=O)C2=C3C=CC=CC3=CC=C2)C2=C3N1[C@H](CN1CCOCC1)COC3=CC=C2
  6. MPEP HCl

    CAS No.: 219911-35-0
    Catalog No.: 106201
    Purity: 95%
    MF: C14H12ClN
    MW: 229.71
    Storage: 2-8 degree Celsius
  7. Nomifensine

    CAS No.: 24526-64-5
    Catalog No.: 106047
    Purity: 95%
    MF: C16H18N2
    MW: 238.334
    Storage: 2-8 degree Celsius
  8. Reversine

    CAS No.: 656820-32-5
    Catalog No.: 106207
    Purity: 95%
    MF: C21H27N7O
    MW: 393.495
    Storage: 2-8 degree Celsius
    SMILES: C1CCC(CC1)NC1=C2NC=NC2=NC(NC2=CC=C(C=C2)N2CCOCC2)=N1
  9. SB408124

    CAS No.: 288150-92-5
    Catalog No.: 106212
    Purity: 95%
    MF: C19H18F2N4O
    MW: 356.376
    Storage: 2-8 degree Celsius
    SMILES: CN(C)C1=CC=C(NC(=O)NC2=CC(C)=NC3=C(F)C=C(F)C=C23)C=C1
  10. WZ811

    CAS No.: 55778-02-4
    Catalog No.: 106219
    Purity: 95%
    MF: C18H18N4
    MW: 290.37
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 422 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5