•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

GPCR & G Protein

Set Descending Direction

   

Items 1 to 10 of 90 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. MRTX849

    CAS No.: 2326521-71-3
    Catalog No.: ZB1917
    Purity: 95%
    MF: C32H35ClFN7O2
    MW: 604.13
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=CC=C2C=CC=C(C12)N1CC=2N=C(N=C(C2CC1)N1C[C@@H](N(CC1)C(C(=C)F)=O)CC#N)OC[C@H]1N(CCC1)C
  2. Citalopram hydrobromide

    CAS No.: 59729-32-7
    Catalog No.: 109749
    Purity: 95%
    MF: C20H22BrFN2O
    MW: 405.311
    Storage: 2-8 degree Celsius
    SMILES: Br[H].CN(C)CCCC1(OCC2=C1C=CC(=C2)C#N)C1=CC=C(F)C=C1
  3. Canagliflozin; JNJ 24831754ZAE; JNJ 28431754; JNJ 28431754AAA; TA 7284

    CAS No.: 842133-18-0
    Catalog No.: 109744
    Purity: 95%
    MF: C24H25FO5S
    MW: 444.524
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC=C(C=C1CC1=CC=C(S1)C1=CC=C(F)C=C1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
  4. Plerixafor; AMD3100

    CAS No.: 110078-46-1
    Catalog No.: 108453
    Purity: 95%
    MF: C28H54N8
    MW: 502.796
    Storage: 2-8 degree Celsius
    SMILES: C(N1CCCNCCNCCCNCC1)C1=CC=C(CN2CCCNCCNCCCNCC2)C=C1
  5. Montelukast Sodium

    CAS No.: 151767-02-1
    Catalog No.: 108353
    Purity: 95%
    MF: C35H35ClNNaO3S
    MW: 608.179
    Storage: 2-8 degree Celsius
    SMILES: [Na+].CC(C)(O)C1=CC=CC=C1CC[C@@H](SCC1(CC([O-])=O)CC1)C1=CC=CC(\C=C\C2=NC3=CC(Cl)=CC=C3C=C2)=C1
  6. Ibutamoren Mesylate; MK-677

    CAS No.: 159752-10-0
    Catalog No.: 104910
    Purity: 95%
    MF: C28H40N4O8S2
    MW: 624.782
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.CC(C)(N)C(=O)N[C@H](COCC1=CC=CC=C1)C(=O)N1CCC2(CN(C3=C2C=CC=C3)S(C)(=O)=O)CC1
  7. AdipoRon

    CAS No.: 924416-43-3
    Catalog No.: 104890
    Purity: 95%
    MF: C27H28N2O3
    MW: 428.532
    Storage: 2-8 degree Celsius
    SMILES: O=C(COC1=CC=C(C=C1)C(=O)C1=CC=CC=C1)NC1CCN(CC2=CC=CC=C2)CC1
  8. WIN 55,212-2 Mesylate

    CAS No.: 131543-23-2
    Catalog No.: 104833
    Purity: 95%
    MF: C28H30N2O6S
    MW: 522.623
    Storage: -20 degree Celsius
    SMILES: CS(O)(=O)=O.CC1=C(C(=O)C2=C3C=CC=CC3=CC=C2)C2=C3N1[C@H](CN1CCOCC1)COC3=CC=C2
  9. Aprepitant; MK-0869; MK-869; L-754030;L-754 030

    CAS No.: 170729-80-3
    Catalog No.: 102605
    Purity: 95%
    MF: C23H21F7N4O3
    MW: 534.432
    Storage: 2-8 degree Celsius
    SMILES: C[C@@H](O[C@H]1OCCN(CC2=NNC(=O)N2)[C@H]1C1=CC=C(F)C=C1)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
  10. Fingolimod (FTY720) HCl

    CAS No.: 162359-56-0
    Catalog No.: 100581
    Purity: 95%
    MF: C19H34ClNO2
    MW: 343.939
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CCCCCCCCC1=CC=C(CCC(N)(CO)CO)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 90 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5