•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

GPCR & G Protein

Set Descending Direction

   

Items 1 to 10 of 421 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Fingolimod (FTY720) HCl

    CAS No.: 162359-56-0
    Catalog No.: 100581
    Purity: 95%
    MF: C19H34ClNO2
    MW: 343.939
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CCCCCCCCC1=CC=C(CCC(N)(CO)CO)C=C1
  2. Siramesine; Lu-28-179

    CAS No.: 147817-50-3
    Catalog No.: 100867
    Purity: 95%
    MF: C30H31FN2O
    MW: 454.589
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)N1C=C(CCCCN2CCC3(CC2)OCC2=C3C=CC=C2)C2=C1C=CC=C2
  3. CGS 21680 HCl; CGS-21680 HCl; CGS21680 HCl

    CAS No.: 124431-80-7
    Catalog No.: 100688
    Purity: 95%
    MF: C23H30ClN7O6
    MW: 535.989
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].CCNC(=O)[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C(N)N=C(NCCC3=CC=C(CCC(O)=O)C=C3)N=C12
  4. MK-0974

    CAS No.: 781649-09-0
    Catalog No.: 101177
    Purity: 95%
    MF: C26H27F5N6O3
    MW: 566.531
    Storage: 2-8 degree Celsius
  5. Aprepitant; MK-0869; MK-869; L-754030;L-754 030

    CAS No.: 170729-80-3
    Catalog No.: 102605
    Purity: 95%
    MF: C23H21F7N4O3
    MW: 534.432
    Storage: 2-8 degree Celsius
  6. TBPB

    CAS No.: 634616-95-8
    Catalog No.: 104417
    Purity: 95%
    MF: C25H32N4O
    MW: 404.558
    Storage: 2-8 degree Celsius
  7. AdipoRon

    CAS No.: 924416-43-3
    Catalog No.: 104890
    Purity: 95%
    MF: C27H28N2O3
    MW: 428.532
    Storage: 2-8 degree Celsius
  8. Ibutamoren Mesylate; MK-677

    CAS No.: 159752-10-0
    Catalog No.: 104910
    Purity: 95%
    MF: C28H40N4O8S2
    MW: 624.782
    Storage: 2-8 degree Celsius
  9. BAN ORL 24

    CAS No.: 475150-69-7
    Catalog No.: 104900
    Purity: 95%
    MF: C27H35N3O2
    MW: 433.596
    Storage: 2-8 degree Celsius
  10. Cinacalcet HCl

    CAS No.: 364782-34-3
    Catalog No.: 104806
    Purity: 95%
    MF: C22H23ClF3N
    MW: 393.88
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].C[C@@H](NCCCC1=CC=CC(=C1)C(F)(F)F)C1=C2C=CC=CC2=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 421 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5