•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Furopyrimidines

Set Descending Direction

   

Items 1 to 10 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 5-bromo-4-chloro-6-(4-fluorophenyl)furo[2,3-d]pyrimidine

    CAS No.: 2058054-73-0
    Catalog No.: TQR1314
    Purity: 95%
    MF: C12H5BrClFN2O
    MW: 327.54
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(OC=2N=CN=C(C21)Cl)C2=CC=C(C=C2)F
  2. 4-chloro-6-(4-methoxyphenyl)furo[2,3-d]pyrimidine

    CAS No.: 866181-79-5
    Catalog No.: TQR1302
    Purity: 95%
    MF: C13H9ClN2O2
    MW: 260.68
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)OC(=C2)C2=CC=C(C=C2)OC
  3. 4-chloro-6-(4-fluorophenyl)furo[2,3-d]pyrimidine

    CAS No.: 1941991-79-2
    Catalog No.: TQR1303
    Purity: 95%
    MF: C12H6ClFN2O
    MW: 248.644
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)OC(=C2)C2=CC=C(C=C2)F
  4. 4-chloro-6-(4-nitrophenyl)furo[2,3-d]pyrimidine

    CAS No.: 475585-11-6
    Catalog No.: TQR1304
    Purity: 95%
    MF: C12H6ClN3O3
    MW: 275.651
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)OC(=C2)C2=CC=C(C=C2)[N+](=O)[O-]
  5. 4-chloro-6-(3-nitrophenyl)furo[2,3-d]pyrimidine

    CAS No.: 475585-22-9
    Catalog No.: TQR1305
    Purity: 95%
    MF: C12H6ClN3O3
    MW: 275.651
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)OC(=C2)C2=CC(=CC=C2)[N+](=O)[O-]
  6. 6-(4-bromophenyl)-4-chlorofuro[2,3-d]pyrimidine

    CAS No.: 887592-53-2
    Catalog No.: TQR1306
    Purity: 95%
    MF: C12H6BrClN2O
    MW: 309.55
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=CC2=C(N=CN=C2Cl)O1
  7. 4-chloro-6-(3-methoxyphenyl)furo[2,3-d]pyrimidine

    CAS No.: 1446023-12-6
    Catalog No.: TQR1307
    Purity: 95%
    MF: C13H9ClN2O2
    MW: 260.68
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)OC(=C2)C2=CC(=CC=C2)OC
  8. 4-chloro-6-(2-methoxyphenyl)furo[2,3-d]pyrimidine

    CAS No.: 1941991-81-6
    Catalog No.: TQR1308
    Purity: 95%
    MF: C13H9ClN2O2
    MW: 260.68
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)OC(=C2)C2=C(C=CC=C2)OC
  9. 5-bromo-4-chloro-6-phenylfuro[2,3-d]pyrimidine

    CAS No.: 1073135-81-5
    Catalog No.: TQR1313
    Purity: 95%
    MF: C12H6BrClN2O
    MW: 309.55
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(OC=2N=CN=C(C21)Cl)C2=CC=CC=C2
  10. 4-chloro-6-phenylfuro[2,3-d]pyrimidine

    CAS No.: 943230-33-9
    Catalog No.: TQR1301
    Purity: 95%
    MF: C12H7ClN2O
    MW: 230.654
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=CN1)OC(=C2)C2=CC=CC=C2
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 34 total

  1. 1
  2. 2
  3. 3
  4. 4