•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Furans

Set Descending Direction

   

Items 1 to 10 of 353 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. methyl 5-((2-fluorophenyl)ethynyl)furan-2-carboxylate

    CAS No.: 725228-58-0
    Catalog No.: 100337
    Purity: 95%
    MF: C14H9FO3
    MW: 244.221
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC=C(O1)C#CC1=CC=CC=C1F
  2. 5-((2-fluorophenyl)ethynyl)furan-2-carboxylic acid

    CAS No.: 725228-51-3
    Catalog No.: 100338
    Purity: 95%
    MF: C13H7FO3
    MW: 230.194
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C(O1)C#CC1=CC=CC=C1F
  3. 5-(3-chlorophenyl)furan-2-carboxylic acid

    CAS No.: 41019-44-7
    Catalog No.: 100566
    Purity: 95%
    MF: C11H7ClO3
    MW: 222.627
    Storage: 2-8 degree Celsius
  4. 5-hydroxy-4-(2-methoxy-5-(trifluoromethyl)phenyl)-5-methylfuran-2(5H)-one

    CAS No.: 1354819-34-3
    Catalog No.: 100673
    Purity: 95%
    MF: C13H11F3O4
    MW: 288.221
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=C1C1=CC(=O)OC1(C)O)C(F)(F)F
  5. dihydrofuran-3(2H)-one

    CAS No.: 22929-52-8
    Catalog No.: 101551
    Purity: 95%
    MF: C4H6O2
    MW: 86.09
    Storage: 2-8 degree Celsius
  6. 5-amino-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-imidazole-4-carboxamide

    CAS No.: 2627-69-2
    Catalog No.: 101573
    Purity: 95%
    MF: C9H14N4O5
    MW: 258.234
    Storage: 2-8 degree Celsius
    SMILES: NC(=O)C1=C(N)N(C=N1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O
  7. 5-formylfuran-2-carboxylic acid

    CAS No.: 13529-17-4
    Catalog No.: 101712
    Purity: 95%
    MF: C6H4O4
    MW: 140.094
    Storage: 2-8 degree Celsius
  8. 5-formylfuran-3-boronic acid

    CAS No.: 62306-80-3
    Catalog No.: 101797
    Purity: 95%
    MF: C5H5BO4
    MW: 139.903
    Storage: 2-8 degree Celsius
  9. 3-furanboronic acid

    CAS No.: 55552-70-0
    Catalog No.: 101814
    Purity: 95%
    MF: C4H5BO3
    MW: 111.893
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=COC=C1
  10. 4-bromo-2-furaldehyde

    CAS No.: 21921-76-6
    Catalog No.: 101816
    Purity: 95%
    MF: C5H3BrO2
    MW: 174.981
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 353 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5