•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Fluorinated

Set Descending Direction

   

Items 1 to 10 of 12440 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-(4-bromophenyl)-3-(trifluoromethyl)-3H-diazirine

    CAS No.: 952143-02-1
    Catalog No.: TQ0144
    Purity: 95%
    MF: C8H4BrF3N2
    MW: 265.032
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1(N=N1)C(F)(F)F
  2. 2-chloro-5-fluoropyridin-4-amine

    CAS No.: 89510-90-7
    Catalog No.: 100004
    Purity: 95%
    MF: C5H4ClFN2
    MW: 146.552
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC(Cl)=NC=C1F
  3. 2-chloro-5-fluoro-3-nitropyridin-4-amine

    CAS No.: 405230-90-2
    Catalog No.: 100005
    Purity: 95%
    MF: C5H3ClFN3O2
    MW: 191.549
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C(Cl)=NC=C1F)[N+]([O-])=O
  4. 2-amino-5-bromo-4-(trifluoromethyl)pyridine

    CAS No.: 944401-56-3
    Catalog No.: 100011
    Purity: 95%
    MF: C6H4BrF3N2
    MW: 241.01
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(Br)C(=C1)C(F)(F)F
  5. 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine

    CAS No.: 944401-57-4
    Catalog No.: 100012
    Purity: 95%
    MF: C12H16BF3N2O2
    MW: 288.078
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)C1=CN=C(N)C=C1C(F)(F)F
  6. 2-bromo-5-fluoro-3-nitropyridin-4-amine

    CAS No.: 1227958-53-3
    Catalog No.: 100013
    Purity: 95%
    MF: C5H3BrFN3O2
    MW: 236
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C(Br)=NC=C1F)[N+]([O-])=O
  7. 2-bromo-5-fluoropyridine-3,4-diamine

    CAS No.: 1227958-29-3
    Catalog No.: 100014
    Purity: 95%
    MF: C5H5BrFN3
    MW: 206.018
    Storage: 2-8 degree Celsius
  8. (S)-N-(1-(5-fluoropyridin-2-yl)ethyl)acetamide

    CAS No.: 905587-17-9
    Catalog No.: 100020
    Purity: 95%
    MF: C9H11FN2O
    MW: 182.198
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC(C)=O)C1=NC=C(F)C=C1
  9. (S)-tert-butyl 1-(5-fluoropyridin-2-yl)ethylcarbamate

    CAS No.: 905587-16-8
    Catalog No.: 100021
    Purity: 95%
    MF: C12H17FN2O2
    MW: 240.278
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](NC(=O)OC(C)(C)C)C1=NC=C(F)C=C1
  10. (S)-1-(5-fluoropyridin-2-yl)ethanamine hydrochloride

    CAS No.: 1073149-00-4
    Catalog No.: 100022
    Purity: 95%
    MF: C7H10ClFN2
    MW: 176.622
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 12440 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5