•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Estrogen/progestogen Receptor

Set Descending Direction

   

Items 1 to 10 of 46 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Amcenestrant (SAR439859)

    CAS No.: 2114339-57-8
    Catalog No.: 193670
    Purity: 95%
    MF: C31H30Cl2FNO3
    MW: 554.489
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC(=C1)Cl)C=1CCCC2=C(C1C1=CC=C(C=C1)O[C@@H]1CN(CC1)CCCF)C=CC(=C2)C(=O)O
  2. Cholesterol

    CAS No.: 57-88-5
    Catalog No.: 151890
    Purity: 95%
    MF: C27H46O
    MW: 386.664
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C
  3. Clomifene citrate

    CAS No.: 50-41-9
    Catalog No.: 151729
    Purity: 95%
    MF: C32H36ClNO8
    MW: 598.092
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CCN(CC)CCOC1=CC=C(C=C1)C(=C(\Cl)C1=CC=CC=C1)\C1=CC=CC=C1
  4. Estradiol Cypionate

    CAS No.: 313-06-4
    Catalog No.: 151857
    Purity: 95%
    MF: C26H36O3
    MW: 396.571
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC[C@H](OC(=O)CCC3CCCC3)[C@@]1(C)CC[C@]1([H])C3=CC=C(O)C=C3CC[C@@]21[H]
  5. Estradiol valerate

    CAS No.: 979-32-8
    Catalog No.: 151826
    Purity: 95%
    MF: C23H32O3
    MW: 356.506
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC[C@H](OC(=O)CCCC)[C@@]1(C)CC[C@]1([H])C3=CC=C(O)C=C3CC[C@@]21[H]
  6. Ethynodiol diacetate

    CAS No.: 297-76-7
    Catalog No.: 151828
    Purity: 95%
    MF: C24H32O4
    MW: 384.516
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC[C@@](OC(C)=O)(C#C)[C@@]1(C)CC[C@]1([H])[C@@]3([H])CC[C@H](OC(C)=O)C=C3CC[C@@]21[H]
  7. Licochalcone A

    CAS No.: 58749-22-7
    Catalog No.: 152096
    Purity: 95%
    MF: C21H22O4
    MW: 338.403
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(\C=C\C(=O)C2=CC=C(O)C=C2)C=C(C(O)=C1)C(C)(C)C=C
  8. Mifepristone

    CAS No.: 84371-65-3
    Catalog No.: 151746
    Purity: 95%
    MF: C29H35NO2
    MW: 429.604
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC[C@@](O)(C#CC)[C@@]1(C)C[C@H](C1=CC=C(C=C1)N(C)C)C1=C3CCC(=O)C=C3CC[C@@]21[H]
  9. Endoxifen E-isomer hydrochloride

    CAS No.: 1197194-61-8
    Catalog No.: 169626
    Purity: 95%
    MF: C25H28ClNO2
    MW: 409.957
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC\C(=C(\C1=CC=C(O)C=C1)C1=CC=C(OCCNC)C=C1)C1=CC=CC=C1
  10. Toremifene HCl

    CAS No.: 89778-25-6
    Catalog No.: 181892
    Purity: 95%
    MF: C26H29Cl2NO
    MW: 442.43
    Storage: 2-8 degree Celsius
    SMILES: Cl.CN(C)CCOC1=CC=C(C=C1)C(=C(\CCCl)C1=CC=CC=C1)\C1=CC=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 46 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5