•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Epigenetics

Set Descending Direction

   

Items 1 to 10 of 200 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. MI-2

    CAS No.: 1271738-62-5
    Catalog No.: 100292
    Purity: 95%
    MF: C18H25N5S2
    MW: 375.567
    Storage: 2-8 degree Celsius
    SMILES: CCCC1=CC2=C(N=CN=C2S1)N1CCN(CC1)C1=NCC(C)(C)S1
  2. Apabetalone; RVX-208; RVX 208

    CAS No.: 1044870-39-4
    Catalog No.: 100796
    Purity: 95%
    MF: C20H22N2O5
    MW: 370.405
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=C(C(=O)NC(=N2)C2=CC(C)=C(OCCO)C(C)=C2)C(OC)=C1
  3. Belinostat; PXD101

    CAS No.: 414864-00-9
    Catalog No.: 101023
    Purity: 95%
    MF: C15H14N2O4S
    MW: 318.354
    Storage: 2-8 degree Celsius
  4. Vorinostat; SAHA; MK0683

    CAS No.: 149647-78-9
    Catalog No.: 101085
    Purity: 95%
    MF: C14H20N2O3
    MW: 264.325
    Storage: 2-8 degree Celsius
  5. Mocetinostat; MGCD0103

    CAS No.: 726169-73-9
    Catalog No.: 101210
    Purity: 95%
    MF: C23H20N6O
    MW: 396.454
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=CC=C1NC(=O)C1=CC=C(CNC2=NC=CC(=N2)C2=CC=CN=C2)C=C1
  6. C646; C 646; C-646

    CAS No.: 328968-36-1
    Catalog No.: 104475
    Purity: 95%
    MF: C24H19N3O6
    MW: 445.431
    Storage: 2-8 degree Celsius
  7. UNC1215; UNC 1215

    CAS No.: 1415800-43-9
    Catalog No.: 104605
    Purity: 95%
    MF: C32H43N5O2
    MW: 529.729
    Storage: 2-8 degree Celsius
    SMILES: O=C(N1CCC(CC1)N1CCCC1)C1=CC=C(C(=O)N2CCC(CC2)N2CCCC2)C(NC2=CC=CC=C2)=C1
  8. CUDC-101

    CAS No.: 1012054-59-9
    Catalog No.: 104818
    Purity: 95%
    MF: C24H26N4O4
    MW: 434.496
    Storage: 2-8 degree Celsius
  9. Decitabine

    CAS No.: 2353-33-5
    Catalog No.: 104930
    Purity: 95%
    MF: C8H12N4O4
    MW: 228.208
    Storage: 2-8 degree Celsius
  10. EX 527; Selisistat

    CAS No.: 49843-98-3
    Catalog No.: 104904
    Purity: 95%
    MF: C13H13ClN2O
    MW: 248.713
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 200 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5