•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

DNA/RNA Synthesis

Set Descending Direction

   

Items 1 to 10 of 67 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Thymidine

    CAS No.: 50-89-5
    Catalog No.: 194897
    Purity: 95%
    MF: C10H14N2O5
    MW: 242.231
    Storage: 2-8 degree Celsius
    SMILES: O[C@H]1C[C@@H](O[C@@H]1CO)N1C(NC(C(=C1)C)=O)=O
  2. L82-G17

    CAS No.: 92285-87-5
    Catalog No.: 194721
    Purity: 95%
    MF: C11H9ClN4O2
    MW: 264.672
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(NN=CC1N\N=C/C1=CC(=CC=C1)O)=O
  3. PCNA-I1

    CAS No.: 444930-42-1
    Catalog No.: 194568
    Purity: 95%
    MF: C17H14N2O2S
    MW: 310.378
    Storage: 2-8 degree Celsius
    SMILES: OC1=C(C=CC2=CC=CC=C12)C=NNC(=O)C=1SC=CC1C
  4. NSC 617145

    CAS No.: 203115-63-3
    Catalog No.: 193782
    Purity: 95%
    MF: C13H10Cl4N2O4
    MW: 400.045
    Storage: 2-8 degree Celsius
    SMILES: CC(CN1C(C(=C(C1=O)Cl)Cl)=O)(CN1C(C(=C(C1=O)Cl)Cl)=O)C
  5. RO6885247

    CAS No.: 1449598-06-4
    Catalog No.: 186326
    Purity: 95%
    MF: C24H28N6O
    MW: 416.529
    Storage: 2-8 degree Celsius
    SMILES: C(C)C=1C=2N(C=C(N1)C)N=C(C2)C=2N=C1N(C(C2)=O)C=C(C=C1C)C1CCN(CC1)C
  6. Rbin-1

    CAS No.: 328023-11-6
    Catalog No.: 186272
    Purity: 95%
    MF: C13H12N4S
    MW: 256.334
    Storage: 2-8 degree Celsius
    SMILES: CC(CSC=1N=NC2=C(NC=3C=CC=CC23)N1)=C
  7. E3330

    CAS No.: 136164-66-4
    Catalog No.: 186148
    Purity: 95%
    MF: C21H30O6
    MW: 378.465
    Storage: 2-8 degree Celsius
    SMILES: COC=1C(C(=C(C(C1OC)=O)\C=C(\C(=O)O)/CCCCCCCCC)C)=O
  8. BMH-21

    CAS No.: 896705-16-1
    Catalog No.: 153178
    Purity: 95%
    MF: C21H20N4O2
    MW: 360.417
    Storage: 2-8 degree Celsius
    SMILES: CN(C)CCNC(=O)C1=CC=CN2C(=O)C3=C(C=C4C=CC=CC4=C3)N=C12
  9. ML 246; Metarrestin

    CAS No.: 1443414-10-5
    Catalog No.: WLZ0226
    Purity: 95%
    MF: C31H30N4O
    MW: 474.608
    Storage: 2-8 degree Celsius
    SMILES: O[C@H]1CC[C@H](N(C=NC2=C3C(C4=CC=CC=C4)=C(C5=CC=CC=C5)N2CC6=CC=CC=C6)C3=N)CC1
  10. Synucleozid

    CAS No.: 502139-01-7
    Catalog No.: 194737
    Purity: 95%
    MF: C22H20N6
    MW: 368.444
    Storage: 2-8 degree Celsius
    SMILES: C(N)(=N)C1=CC=C(C=C1)NC1=CC=C(C=C1)C=1NC2=CC(=CC=C2C1)C(N)=N
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 67 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5