•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Difluoromethyls

Set Descending Direction

   

Items 1 to 10 of 599 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-(difluoromethyl)-1H-pyrazol-3-amine

    CAS No.: 1284220-49-0
    Catalog No.: 101277
    Purity: 95%
    MF: C4H5F2N3
    MW: 133.101
    Storage: 2-8 degree Celsius
    SMILES: NC1=NNC(=C1)C(F)F
  2. 2-difluoromethyl-1H-benzoimidazole

    CAS No.: 705-09-9
    Catalog No.: 101294
    Purity: 95%
    MF: C8H6F2N2
    MW: 168.146
    Storage: 2-8 degree Celsius
  3. 5-(difluoromethyl)-1,3,4-thiadiazol-2-amine

    CAS No.: 25306-15-4
    Catalog No.: 112506
    Purity: 95%
    MF: C3H3F2N3S
    MW: 151.141
    Storage: 2-8 degree Celsius
  4. (3-(difluoromethyl)phenyl)boronic acid

    CAS No.: 854690-87-2
    Catalog No.: 124397
    Purity: 95%
    MF: C7H7BF2O2
    MW: 171.939
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=CC=CC(=C1)C(F)F
  5. (4-(difluoromethyl)phenyl)boronic acid

    CAS No.: 946525-43-5
    Catalog No.: 124398
    Purity: 95%
    MF: C7H7BF2O2
    MW: 171.939
    Storage: 2-8 degree Celsius
  6. (3-(difluoromethyl)-4-methoxyphenyl)boronic acid

    CAS No.: 1704065-70-2
    Catalog No.: 124399
    Purity: 95%
    MF: C8H9BF2O3
    MW: 201.965
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(C=C1C(F)F)B(O)O
  7. (3-(difluoromethyl)-4-fluorophenyl)boronic acid

    CAS No.: 1254118-35-8
    Catalog No.: 124407
    Purity: 93%
    MF: C7H6BF3O2
    MW: 189.929
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=CC=C(F)C(=C1)C(F)F
  8. 2-(3-(difluoromethyl)-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

    CAS No.: 445303-65-1
    Catalog No.: 124732
    Purity: 93%
    MF: C13H16BF3O2
    MW: 272.075
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)OB(OC1(C)C)C1=CC=C(F)C(=C1)C(F)F
  9. 2-(5-(difluoromethyl)-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

    CAS No.: 1142228-23-6
    Catalog No.: 124733
    Purity: 95%
    MF: C13H16BF3O2
    MW: 272.075
    Storage: 2-8 degree Celsius
  10. 2-bromo-4-(difluoromethyl)-N,N-dimethylaniline

    CAS No.: 1704069-42-0
    Catalog No.: 127327
    Purity: 95%
    MF: C9H10BrF2N
    MW: 250.086
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 599 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5