•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Difluoromethoxyls

Set Ascending Direction

   

Items 51 to 60 of 182 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. 3-bromo-5-(difluoromethoxy)pyridine

    CAS No.: 342602-27-1
    Catalog No.: TQU0491
    Purity: 95%
    MF: C6H4BrF2NO
    MW: 224.004
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=NC=C(C1)OC(F)F
  2. 5-bromo-3-(difluoromethoxy)pyridin-2(1H)-one

    CAS No.: 1241752-49-7
    Catalog No.: TQU0492
    Purity: 95%
    MF: C6H4BrF2NO2
    MW: 240.003
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C(NC1)=O)OC(F)F
  3. 3-bromo-4-(difluoromethoxy)pyridine

    CAS No.: 1214377-46-4
    Catalog No.: TQU0494
    Purity: 95%
    MF: C6H4BrF2NO
    MW: 224.004
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=NC=CC1OC(F)F
  4. 5-bromo-4-(difluoromethoxy)-2-fluoropyridine

    CAS No.: 1610027-89-8
    Catalog No.: TQU0495
    Purity: 95%
    MF: C6H3BrF3NO
    MW: 241.994
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=CC(=NC1)F)OC(F)F
  5. 2-chloro-4-(difluoromethoxy)pyridine

    CAS No.: 1206978-15-5
    Catalog No.: TQU0496
    Purity: 95%
    MF: C6H4ClF2NO
    MW: 179.553
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC(=C1)OC(F)F
  6. 2,6-dichloro-4-(difluoromethoxy)pyridine

    CAS No.: 1214379-42-6
    Catalog No.: TQU0497
    Purity: 95%
    MF: C6H3Cl2F2NO
    MW: 213.998
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC(=C1)OC(F)F)Cl
  7. 5-bromo-2-chloro-4-(difluoromethoxy)pyridine

    CAS No.: 1798295-14-3
    Catalog No.: TQU0498
    Purity: 95%
    MF: C6H3BrClF2NO
    MW: 258.449
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=CC(=NC1)Cl)OC(F)F
  8. 2-chloro-3-(difluoromethoxy)pyridine

    CAS No.: 1206977-80-1
    Catalog No.: TQU0499
    Purity: 95%
    MF: C6H4ClF2NO
    MW: 179.553
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC=C1OC(F)F
  9. 2-chloro-5-(difluoromethoxy)pyridine

    CAS No.: 1206980-28-0
    Catalog No.: TQU0500
    Purity: 95%
    MF: C6H4ClF2NO
    MW: 179.553
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=C(C=C1)OC(F)F
  10. 3-chloro-5-(difluoromethoxy)picolinic acid

    CAS No.: 1262860-72-9
    Catalog No.: TQU0501
    Purity: 95%
    MF: C7H4ClF2NO3
    MW: 223.562
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=NC=C(C1)OC(F)F)C(=O)O
Loading ...Load More ...
Set Ascending Direction

   

Items 51 to 60 of 182 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8