•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Diazirines

Set Ascending Direction

   

Items 1 to 10 of 42 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (S)-2-((tert-butoxycarbonyl)amino)-3-(3-methyl-3H-diazirin-3-yl)propanoic acid

    CAS No.: 1000770-97-7
    Catalog No.: TQR0896
    Purity: 95%
    MF: C10H17N3O4
    MW: 243.263
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@H](C(=O)O)CC1(N=N1)C
  2. 2-(3-methyl-3H-diazirin-3-yl)acetic acid

    CAS No.: 16297-95-3
    Catalog No.: TQP0878
    Purity: 95%
    MF: C4H6N2O2
    MW: 114.104
    Storage: 2-8 degree Celsius
    SMILES: CC1(N=N1)CC(=O)O
  3. 3-(3-(but-3-yn-1-yl)-3H-diazirin-3-yl)propanenitrile

    CAS No.: 1450754-43-4
    Catalog No.: TQP0880
    Purity: 95%
    MF: C8H9N3
    MW: 147.181
    Storage: 2-8 degree Celsius
    SMILES: C(CC#C)C1(N=N1)CCC#N
  4. 3-(3-methyl-3H-diazirin-3-yl)-2-phenylpropanoic acid

    CAS No.: 16297-96-4
    Catalog No.: TQP0881
    Purity: 95%
    MF: C11H12N2O2
    MW: 204.229
    Storage: 2-8 degree Celsius
    SMILES: CC1(N=N1)CC(C(=O)O)C1=CC=CC=C1
  5. 3-(3-methyl-3H-diazirin-3-yl)propanehydrazide

    CAS No.: 25055-94-1
    Catalog No.: TQP0882
    Purity: 95%
    MF: C5H10N4O
    MW: 142.162
    Storage: 2-8 degree Celsius
    SMILES: CC1(N=N1)CCC(=O)NN
  6. (S)-2-((tert-butoxycarbonyl)amino)-4-(3-methyl-3H-diazirin-3-yl)butanoic acid

    CAS No.: 1002754-75-7
    Catalog No.: TQP0883
    Purity: 95%
    MF: C11H19N3O4
    MW: 257.29
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@H](C(=O)O)CCC1(N=N1)C
  7. (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-(3-methyl-3H-diazirin-3-yl)butanoic acid

    CAS No.: 945859-89-2
    Catalog No.: TQP0884
    Purity: 95%
    MF: C21H21N3O4
    MW: 379.416
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=CC=2C3=CC=CC=C3C(C12)COC(=O)N[C@H](C(=O)O)CCC1(N=N1)C
  8. (4-(3-(trifluoromethyl)-3H-diazirin-3-yl)phenyl)methanamine

    CAS No.: 400781-05-7
    Catalog No.: TQP0887
    Purity: 95%
    MF: C9H8F3N3
    MW: 215.178
    Storage: 2-8 degree Celsius
    SMILES: FC(C1(N=N1)C1=CC=C(C=C1)CN)(F)F
  9. 2-methoxy-4-(3-(trifluoromethyl)-3H-diazirin-3-yl)benzaldehyde

    CAS No.: 205485-25-2
    Catalog No.: TQP0888
    Purity: 95%
    MF: C10H7F3N2O2
    MW: 244.172
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=O)C=CC(=C1)C1(N=N1)C(F)(F)F
  10. 3-(3-(trifluoromethyl)-3H-diazirin-3-yl)phenol

    CAS No.: 113787-85-2
    Catalog No.: TQP0889
    Purity: 95%
    MF: C8H5F3N2O
    MW: 202.135
    Storage: 2-8 degree Celsius
    SMILES: FC(C1(N=N1)C=1C=C(C=CC1)O)(F)F
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 42 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5